Name |
7-Methyljuglone Ramentaceone |
Formula |
C11H8O3 |
Mw |
188.04734412 |
CAS RN |
14787-38-3 |
C_ID |
C00002859
,
|
InChIKey |
OZUSCVSONBBWOR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C11H8O3/c1-6-4-7-8(12)2-3-9(13)11(7)10(14)5-6/h2-5,14H,1H3 |
SMILES |
c1(cc(c2c(c1)C(=O)C=CC2=O)O)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Droseraceae | Drosera rotundifolia L. | Ref. |
Plantae | Droseraceae | Drosera spp. | Ref. |
Plantae | Ebenaceae | Diospyros alboflavescens | Ref. |
Plantae | Ebenaceae | Diospyros austroafricana | Ref. |
Plantae | Ebenaceae | Diospyros chamaethamnus | Ref. |
Plantae | Ebenaceae | Diospyros chloroxylon | Ref. |
Plantae | Ebenaceae | Diospyros ebenaster | Ref. |
Plantae | Ebenaceae | Diospyros ebenum | Ref. |
Plantae | Ebenaceae | Diospyros ferrea | Ref. |
Plantae | Ebenaceae | Diospyros fischeri | Ref. |
Plantae | Ebenaceae | Diospyros gilleti | Ref. |
Plantae | Ebenaceae | Diospyros guianensis | Ref. |
Plantae | Ebenaceae | Diospyros heterotricha | Ref. |
Plantae | Ebenaceae | Diospyros hoyleana | Ref. |
Plantae | Ebenaceae | Diospyros inhacaensis | Ref. |
Plantae | Ebenaceae | Diospyros ismailii | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros kaki var.sylvestris | Ref. |
Plantae | Ebenaceae | Diospyros lotus | Ref. |
Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
Plantae | Ebenaceae | Diospyros mannii | Ref. |
Plantae | Ebenaceae | Diospyros manrii | Ref. |
Plantae | Ebenaceae | Diospyros maritima | Ref. |
Plantae | Ebenaceae | Diospyros melanoxylon | Ref. |
Plantae | Ebenaceae | Diospyros montana | Ref. |
Plantae | Ebenaceae | Diospyros moonii | Ref. |
Plantae | Ebenaceae | Diospyros natalensis | Ref. |
Plantae | Ebenaceae | Diospyros nicaragunesis | Ref. |
Plantae | Ebenaceae | Diospyros rotundifolia | Ref. |
Plantae | Ebenaceae | Diospyros squarrosa | Ref. |
Plantae | Ebenaceae | Diospyros sumatrana | Ref. |
Plantae | Ebenaceae | Diospyros usambarensis | Ref. |
Plantae | Ebenaceae | Diospyros verrucosa | Ref. |
Plantae | Ebenaceae | Diospyros virginiana | Ref. |
Plantae | Ebenaceae | Diospyros whyteana | Ref. |
Plantae | Ebenaceae | Diospyros zombensis | Ref. |
Plantae | Ebenaceae | Euclea divinorum | Ref. |
Plantae | Ebenaceae | Euclea spp. | Ref. |
Plantae | Ebenaceae | Maba buxifolia | Ref. |
|
|
zoom in
Organism | Diospyros lotus | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Mallavadhani,Phytochem.,49,(1998),901 |
---|
|