| Name |
(-)-Isocorypalmine
Isocorypalmine
O10-Methylstepholidine
Tetrahydrocolumbamine
(S)-Tetrahydrocolumbamine |
| Formula |
C20H23NO4 |
| Mw |
341.16270823 |
| CAS RN |
483-34-1 |
| C_ID |
C00025632
, 
|
| InChIKey |
KDFKJOFJHSVROC-XISACWJONA-N |
| InChICode |
InChI=1S/C20H23NO4/c1-23-18-5-4-12-8-16-14-10-17(22)19(24-2)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,9-10,16,22H,6-8,11H2,1-3H3/t16-/m0/s1 |
| SMILES |
c1c(c(c2c(c1)C[C@@H]1N(C2)CCc2c1cc(c(c2)OC)O)OC)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Enantia chlorantha  | Ref. |
| Plantae | Berberidaceae | Berberis aquifolium | Ref. |
| Plantae | Berberidaceae | Berberis aristata | Ref. |
| Plantae | Berberidaceae | Berberis thunbergii | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris | Ref. |
| Plantae | Berberidaceae | Berberis wilsoniae | Ref. |
| Plantae | Berberidaceae | Mahonia aquifolium | Ref. |
| Plantae | Fumariaceae | Corydalis cava | Ref. |
| Plantae | Fumariaceae | Corydalis esquirolii | Ref. |
| Plantae | Fumariaceae | Corydalis omeiensis | Ref. |
| Plantae | Fumariaceae | Corydalis ophiocarpa Thoms | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo | Ref. |
| Plantae | Menispermaceae | Stephania mashanica H.S.Lo.et.B.N.Chang | Ref. |
| Plantae | Papaveraceae | Argemone mexicana | Ref. |
| Plantae | Papaveraceae | Chelidonium majus | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica | Ref. |
| Plantae | Papaveraceae | Macleaya cordata | Ref. |
| Plantae | Papaveraceae | Papaver bracteatum | Ref. |
| Plantae | Papaveraceae | Papaver somniferum | Ref. |
| Plantae | Papaveraceae | Papaver triniifolium | Ref. |
| Plantae | Ranunculaceae | Coptis japonica | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis L. | Ref. |
| Plantae | Rutaceae | Phellodendron chinensis | Ref. |
| Plantae | Rutaceae | Zanthoxylum taediosum | Ref. |
| - | - | Mohonia bealei | Ref. |
|
|
zoom in
| Organism | Papaver somniferum |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Hwang, et al., Planta Med, 69, (2003), 623.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
