Name |
(+)-Lirioresinol B (+)-Syringaresinol |
Formula |
C22H26O8 |
Mw |
418.16276781 |
CAS RN |
21453-69-0 |
C_ID |
C00002631
,
|
InChIKey |
KOWMJRJXZMEZLD-RONXCAPDNA-N |
InChICode |
InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1 |
SMILES |
[C@@H]12[C@@H]([C@H](OC1)c1cc(c(c(c1)OC)O)OC)CO[C@@H]2c1cc(c(c(c1)OC)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Justicia glauca | Ref. |
Plantae | Acanthaceae | Phlogacanthus curviflorus | Ref. |
Plantae | Actinidiaceae | Actinidia arguta | Ref. |
Plantae | Adoxaceae | Sambucus sieboldiana | Ref. |
Plantae | Alliaceae | Allium tuberosum | Ref. |
Plantae | Annonaceae | Annona cherimola | Ref. |
Plantae | Annonaceae | Annona montana | Ref. |
Plantae | Annonaceae | Annona senegalensis | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
Plantae | Annonaceae | Asimina parviflora | Ref. |
Plantae | Annonaceae | Asimina triloba | Ref. |
Plantae | Annonaceae | Rollinia emarginata | Ref. |
Plantae | Apocynaceae | Allamanda neriifolia | Ref. |
Plantae | Apocynaceae | Asclepias curassavica L. | Ref. |
Plantae | Apocynaceae | Beaumontia brevituba | Ref. |
Plantae | Apocynaceae | Beaumontia grandiflora | Ref. |
Plantae | Apocynaceae | Marsdenia oreophila | Ref. |
Plantae | Apocynaceae | Plumeria rubra | Ref. |
Plantae | Apocynaceae | Poacynum hendersonii | Ref. |
Plantae | Apocynaceae | Vinca major var. variegata | Ref. |
Plantae | Apocynaceae | Vinca minor | Ref. |
Plantae | Aquifoliaceae | Ilex asprella | Ref. |
Plantae | Araceae | Arum italicum | Ref. |
Plantae | Araceae | Rhaphidophora decursiva | Ref. |
Plantae | Araliaceae | Acanthopanax sessiliflorus | Ref. |
Plantae | Araliaceae | Aralia bipinnata | Ref. |
Plantae | Araliaceae | Aralia elata | Ref. |
Plantae | Araliaceae | Dendropanax chevalieri | Ref. |
Plantae | Araliaceae | Eleutherococcus brachypus | Ref. |
Plantae | Araliaceae | Eleutherococcus divaricatus var. chiisanensis | Ref. |
Plantae | Araliaceae | Eleutherococcus giraldii | Ref. |
Plantae | Araliaceae | Eleutherococcus henryi | Ref. |
Plantae | Araliaceae | Eleutherococcus koreanus | Ref. |
Plantae | Araliaceae | Eleutherococcus obovatus | Ref. |
Plantae | Araliaceae | Eleutherococcus senticosus | Ref. |
Plantae | Araliaceae | Eleutherococcus sessiliflorus | Ref. |
Plantae | Araliaceae | Eleutherococcus setchuenensis | Ref. |
Plantae | Araliaceae | Kalopanax pictus | Ref. |
Plantae | Araliaceae | Kalopanax septemlobus | Ref. |
Plantae | Asteraceae | Artemisia apiacea | Ref. |
Plantae | Asteraceae | Artemisia caruifolia | Ref. |
Plantae | Asteraceae | Carduus tenuiflorus | Ref. |
Plantae | Asteraceae | Centaurea solstitialis | Ref. |
Plantae | Asteraceae | Erigeron breviscapus | Ref. |
Plantae | Asteraceae | Ixeris sonchifolia | Ref. |
Plantae | Asteraceae | Ophryosporus piquerioides | Ref. |
Plantae | Asteraceae | Parthenium hysterophorus | Ref. |
Plantae | Asteraceae | Pluchea indica | Ref. |
Plantae | Asteraceae | Saussurea medusa | Ref. |
Plantae | Asteraceae | Scorzonera hispanica | Ref. |
Plantae | Berberidaceae | Berberis chilensis | Ref. |
Plantae | Berberidaceae | Berberis darwinii | Ref. |
Plantae | Berberidaceae | Epimedium koreanum | Ref. |
Plantae | Berberidaceae | Mahonia aquifolium | Ref. |
Plantae | Buddlejaceae | Buddleja davidii | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera gracilipes var. glandulosa | Ref. |
Plantae | Celastraceae | Gymnosporia trigyna | Ref. |
Plantae | Celastraceae | Maytenus aquifolium | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Convallariaceae | Polygonatum sibiricum | Ref. |
Plantae | Convallariaceae | Tupistra chinensis | Ref. |
Plantae | Cornaceae | Camptotheca acuminata | Ref. |
Plantae | Desfontainiaceae | Desfontainia spinosa | Ref. |
Plantae | Dilleniaceae | Doliocarpus dentatus | Ref. |
Plantae | Dioscoreaceae | Dioscorea spongiosa | Ref. |
Plantae | Ebenaceae | Diospyros eriantha | Ref. |
Plantae | Ephedraceae | Ephedra alata | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides | Ref. |
Plantae | Euphorbiaceae | Trigonostemon reidioides | Ref. |
Plantae | Fabaceae | Albizia falcataria | Ref. |
Plantae | Fabaceae | Albizia julibrissin | Ref. |
Plantae | Fabaceae | Albizia myriophylla | Ref. |
Plantae | Fabaceae | Astragalus mongholicus | Ref. |
Plantae | Fabaceae | Caragana tibetica | Ref. |
Plantae | Fabaceae | Euchresta formosana | Ref. |
Plantae | Fabaceae | Sophora substrata | Ref. |
Plantae | Fagaceae | Fagus sylvatica | Ref. |
Plantae | Gentianaceae | Swertia chirata | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Globulariaceae | Globularia alypum | Ref. |
Plantae | Globulariaceae | Globularia trichosantha | Ref. |
Plantae | Gnetaceae | Gnetum gnemon | Ref. |
Plantae | Hypericaceae | Vismia guaramirangae | Ref. |
Plantae | Labiatae | Gmelina vitiensis | Ref. |
Plantae | Labiatae | Phlomis aurea | Ref. |
Plantae | Labiatae | Phlomis fruticosa | Ref. |
Plantae | Labiatae | Scutellaria albida ssp. colchica | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Scutellaria scandens | Ref. |
Plantae | Labiatae | Scutellaria strigillosa | Ref. |
Plantae | Lardizabalaceae | Sargentodoxa cuneata | Ref. |
Plantae | Lauraceae | Actinodaphne lancifolia | Ref. |
Plantae | Lauraceae | Apollonias barbujana | Ref. |
Plantae | Lauraceae | Cassytha filiformis | Ref. |
Plantae | Lauraceae | Cinnamomum burmannii Nees ex BI | Ref. |
Plantae | Lauraceae | Cinnamomum subavenium | Ref. |
Plantae | Lauraceae | Cinnamomum tenuifolium | Ref. |
Plantae | Lauraceae | Lindera obtusiloba | Ref. |
Plantae | Lauraceae | Machilus thunbergii | Ref. |
Plantae | Lauraceae | Neolitsea acuminatissima | Ref. |
Plantae | Lauraceae | Ocotea duckei | Ref. |
Plantae | Liliaceae | Fritillaria thunbergii | Ref. |
Plantae | Longaniaceae | Strychnos dinklagei | Ref. |
Plantae | Magnoliaceae | Kmeria duperreana | Ref. |
Plantae | Magnoliaceae | Liriodendron tulipifera | Ref. |
Plantae | Magnoliaceae | Magnolia coco | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia grandiflora var. rubra | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Magnoliaceae | Manglietia crassipes | Ref. |
Plantae | Magnoliaceae | Manglietiastrum sinicum | Ref. |
Plantae | Magnoliaceae | Michelia fuscata | Ref. |
Plantae | Magnoliaceae | Michelia sphaerantha | Ref. |
Plantae | Malvaceae | Hibiscus cannabinus | Ref. |
Plantae | Malvaceae | Hibiscus syriacus | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Meliaceae | Aglaia odorata | Ref. |
Plantae | Menispermaceae | Cocculus hirsutus | Ref. |
Plantae | Menispermaceae | Sinomenium acutum | Ref. |
Plantae | Nolinaceae | Nolina microcarpa | Ref. |
Plantae | Nyctaginaceae | Boerhavia diffusa | Ref. |
Plantae | Oleaceae | Fraxinus mandshurica var. japonica | Ref. |
Plantae | Oleaceae | Ligustrum lucidum | Ref. |
Plantae | Oleaceae | Osmanthus asiaticus | Ref. |
Plantae | Oleaceae | Syringa velutina | Ref. |
Plantae | Oleaceae | Syringa vulgaris | Ref. |
Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
Plantae | Orchidaceae | Dendrobium spp. | Ref. |
Plantae | Orchidaceae | Ephemerantha fimbriata | Ref. |
Plantae | Orchidaceae | Luisia volucris | Ref. |
Plantae | Orobanchaceae | Cistanche deserticola | Ref. |
Plantae | Orobanchaceae | Cistanche salsa | Ref. |
Plantae | Orobanchaceae | Cistanche tubulosa | Ref. |
Plantae | Orobanchaceae | Pedicularis alaschanica | Ref. |
Plantae | Orobanchaceae | Pedicularis chinensis | Ref. |
Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
Plantae | Orobanchaceae | Pedicularis semitorta | Ref. |
Plantae | Palmae | Daemonorops draco | Ref. |
Plantae | Phyllanthaceae | Antidesma membranaceum | Ref. |
Plantae | Phyllanthaceae | Phyllanthus virgatus | Ref. |
Plantae | Plantaginaceae | Linaria vulgaris | Ref. |
Plantae | Plantaginaceae | Penstemon deustus | Ref. |
Plantae | Ranunculaceae | Clematis chinensis | Ref. |
Plantae | Ranunculaceae | Coptis japonica var. dissecta | Ref. |
Plantae | Rhamnaceae | Hovenia trichocarea | Ref. |
Plantae | Rosaceae | Coleogyne ramosissima | Ref. |
Plantae | Rosaceae | Malus domestica | Ref. |
Plantae | Rubiaceae | Galium sinaicum | Ref. |
Plantae | Rubiaceae | Putoria calabrica | Ref. |
Plantae | Rubiaceae | Tarenna attenuata | Ref. |
Plantae | Rutaceae | Haplophyllum vulcanicum | Ref. |
Plantae | Rutaceae | Limonia acidissima | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Rutaceae | Zanthoxylum acanthopodium | Ref. |
Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
Plantae | Rutaceae | Zanthoxylum arnottianum | Ref. |
Plantae | Rutaceae | Zanthoxylum inerme | Ref. |
Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
Plantae | Rutaceae | Zanthoxylum myriacanthum | Ref. |
Plantae | Rutaceae | Zanthoxylum nitidum | Ref. |
Plantae | Rutaceae | Zanthoxylum oxyphyllum | Ref. |
Plantae | Rutaceae | Zanthoxylum setulosum | Ref. |
Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
Plantae | Salicaceae | Populus spp. | Ref. |
Plantae | Salicaceae | Salix sachalinensis | Ref. |
Plantae | Salvadoraceae | Salvadora persica | Ref. |
Plantae | Santalaceae | Viscum album var. coloratum | Ref. |
Plantae | Simaroubaceae | Holacantha emoryi | Ref. |
Plantae | Simaroubaceae | Leitneria floridana | Ref. |
Plantae | Solanaceae | Nicotiana acuminata | Ref. |
Plantae | Symplocaceae | Symplocos lancifolia | Ref. |
Plantae | Tamaricaceae | Tamarix nilotica | Ref. |
Plantae | Thymelaeaceae | Daphne mezereum | Ref. |
Plantae | Thymelaeaceae | Daphne tangutica | Ref. |
Plantae | Thymelaeaceae | Dirca occidentalis | Ref. |
Plantae | Thymelaeaceae | Gyrinops walla | Ref. |
Plantae | Thymelaeaceae | Lasiosiphon eriocephalus | Ref. |
Plantae | Thymelaeaceae | Passerina vulgaris | Ref. |
Plantae | Thymelaeaceae | Stellera chamaejasme | Ref. |
Plantae | Thymelaeaceae | Wikstroemia elliptica | Ref. |
Plantae | Thymelaeaceae | Wikstroemia indica | Ref. |
Plantae | Thymelaeaceae | Wikstroemia spp. | Ref. |
Plantae | Trochodendraceae/Tetracentraceae | Trochodendron aralioides | Ref. |
Plantae | Ulmaceae | Pteroceltis tatarinowii | Ref. |
- | - | Selaginella doederleinii | Ref. |
|
|
zoom in
Organism | Wikstroemia indica | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., APS, 34, (1999), 605.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
MA, et al., Chem Pharm Bull, 49, (2001), 183.
XIANG, et al., Chem Pharm Bull, 53, (2005), 1204.
WANG, et al., Chem Pharm Bull, 53, (2005), 1348.
XIE, et al., Chem Pharm Bull, 53, (2005), 1416.
Pan, et al., JNP, 66, (2003), 161.
Yuan, et al., JNP, 68, (2005), 86.
Yin, et al., Planta Med, 70, (2004), 54 |
---|
|