Name |
Catechin (+)-Catechin D-Catechin (+)-3',4',5,7-Tetrahydroxy-2,3-trans-flavan-3-ol Dexcyanidanol Teafuran 30A D-Catechol |
Formula |
C15H14O6 |
Mw |
290.07903818 |
CAS RN |
154-23-4 |
C_ID |
C00000947
,
|
InChIKey |
PFTAWBLQPZVEMU-UYWMCZCJNA-N |
InChICode |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H]([C@H](C2)O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
Plantae | Annonaceae | Mitrella kentii | Ref. |
Plantae | Apocynaceae | Apocynum venetum | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Betulaceae | Betula papyrifera | Ref. |
Plantae | Betulaceae | Carpinus cordata | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Casuarinaceae | Casuarina equisetifolia L. | Ref. |
Plantae | Celastraceae | Gymnosporia trigyna | Ref. |
Plantae | Celastraceae | Salacia prinoides | Ref. |
Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
Plantae | Cistaceae | Cistus salviifolius | Ref. |
Plantae | Combretaceae | Combretum quadrangulare | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Elaeagnaceae | Elaeagnus angustifolia | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
Plantae | Ericaceae | Rhododendron calophytum | Ref. |
Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
Plantae | Ericaceae | Rhododendron degronianum ssp. Heptamerum var. hondoense | Ref. |
Plantae | Ericaceae | Rhododendron dichroanthum ssp.scyphocalyx | Ref. |
Plantae | Ericaceae | Rhododendron fortunei | Ref. |
Plantae | Ericaceae | Rhododendron galactinum | Ref. |
Plantae | Ericaceae | Rhododendron insigne | Ref. |
Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
Plantae | Ericaceae | Rhododendron oreotrephes | Ref. |
Plantae | Ericaceae | Rhododendron ponticum | Ref. |
Plantae | Ericaceae | Rhododendron praevernum | Ref. |
Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
Plantae | Ericaceae | Rhododendron ungernii | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Erythroxylaceae | Erythroxylum cambodianum | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides Oliver | Ref. |
Plantae | Euphorbiaceae | Croton urucurana | Ref. |
Plantae | Fabaceae | Acacia adunca | Ref. |
Plantae | Fabaceae | Acacia calamifolia | Ref. |
Plantae | Fabaceae | Acacia cardiophylla | Ref. |
Plantae | Fabaceae | Acacia catechu | Ref. |
Plantae | Fabaceae | Acacia chrysotricha | Ref. |
Plantae | Fabaceae | Acacia clunies-rossiae | Ref. |
Plantae | Fabaceae | Acacia concurrens | Ref. |
Plantae | Fabaceae | Acacia constablei | Ref. |
Plantae | Fabaceae | Acacia cultriformis | Ref. |
Plantae | Fabaceae | Acacia dealbata | Ref. |
Plantae | Fabaceae | Acacia deanei | Ref. |
Plantae | Fabaceae | Acacia decurrens | Ref. |
Plantae | Fabaceae | Acacia elata | Ref. |
Plantae | Fabaceae | Acacia erioloba | Ref. |
Plantae | Fabaceae | Acacia falciformis | Ref. |
Plantae | Fabaceae | Acacia filicifolia | Ref. |
Plantae | Fabaceae | Acacia fimbriata | Ref. |
Plantae | Fabaceae | Acacia holosericea | Ref. |
Plantae | Fabaceae | Acacia irrorata | Ref. |
Plantae | Fabaceae | Acacia ixiophylla | Ref. |
Plantae | Fabaceae | Acacia kettlewelliae | Ref. |
Plantae | Fabaceae | Acacia lanigera | Ref. |
Plantae | Fabaceae | Acacia leucoclada | Ref. |
Plantae | Fabaceae | Acacia longifolia | Ref. |
Plantae | Fabaceae | Acacia mabellae | Ref. |
Plantae | Fabaceae | Acacia mearnsii | Ref. |
Plantae | Fabaceae | Acacia melanoxylon | Ref. |
Plantae | Fabaceae | Acacia mollifolia | Ref. |
Plantae | Fabaceae | Acacia neriifolia | Ref. |
Plantae | Fabaceae | Acacia nilotica | Ref. |
Plantae | Fabaceae | Acacia obtusifolia | Ref. |
Plantae | Fabaceae | Acacia omalophylla | Ref. |
Plantae | Fabaceae | Acacia oshanesii | Ref. |
Plantae | Fabaceae | Acacia oswaldii | Ref. |
Plantae | Fabaceae | Acacia parramattensis | Ref. |
Plantae | Fabaceae | Acacia pendula | Ref. |
Plantae | Fabaceae | Acacia planifrons | Ref. |
Plantae | Fabaceae | Acacia retinodes | Ref. |
Plantae | Fabaceae | Acacia rigens | Ref. |
Plantae | Fabaceae | Acacia silvestris | Ref. |
Plantae | Fabaceae | Acacia terminalis | Ref. |
Plantae | Fabaceae | Acacia trachyphloia | Ref. |
Plantae | Fabaceae | Acacia verniciflua | Ref. |
Plantae | Fabaceae | Acacia vestita | Ref. |
Plantae | Fabaceae | Alhagi kirghisorum | Ref. |
Plantae | Fabaceae | Alhagi maurorum | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Astragalus floccosifolius | Ref. |
Plantae | Fabaceae | Astragalus kabadianus | Ref. |
Plantae | Fabaceae | Cassia fistula | Ref. |
Plantae | Fabaceae | Cassia roxburghii | Ref. |
Plantae | Fabaceae | Colophospermum mopane | Ref. |
Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
Plantae | Fabaceae | Gleditsia triacanthos | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Parkia biglobosa | Ref. |
Plantae | Fabaceae | Prosopis nigra | Ref. |
Plantae | Fabaceae | Prosopis torquata | Ref. |
Plantae | Fabaceae | Schotia brachypetala | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vigna angularis | Ref. |
Plantae | Fabaceae | Wisteria sinensis | Ref. |
Plantae | Fagaceae | Quercus robur | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Grossulariaceae | Ribes fasciculatum var.chinense | Ref. |
Plantae | Hamamelidaceae | Liquidambar styraciflua | Ref. |
Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
Plantae | Lauraceae | Cinnamomum sieboldii | Ref. |
Plantae | Lauraceae | Cinnamomum subavenium | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lauraceae | Machilus thunbergii | Ref. |
Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Lythraceae | Punica granatum L. | Ref. |
Plantae | Malvaceae | Ceiba pentandra | Ref. |
Plantae | Malvaceae | Cola acuminata | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Malvaceae | Theobroma grandiflorum | Ref. |
Plantae | Meliaceae | Melia azedarach var.japonica | Ref. |
Plantae | Meliaceae | Toona sinensis | Ref. |
Plantae | Meliaceae | Xylocarpus granatum | Ref. |
Plantae | Moraceae | Artocarpus dadah | Ref. |
Plantae | Musaceae | Musa acuminata | Ref. |
Plantae | Myrsinaceae | Embelia ribes Burm. | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Palmae | Areca catechu | Ref. |
Plantae | Palmae | Chamaerops humilis | Ref. |
Plantae | Palmae | Desmoncus polyacanthos | Ref. |
Plantae | Palmae | Phoenix hanceana var. formosana | Ref. |
Plantae | Palmae | Trachycarpus fortunei | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Pinaceae | Larix decidua Miller. | Ref. |
Plantae | Pinaceae | Larix sibirica | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Pinus sibirica L. | Ref. |
Plantae | Pinaceae | Pinus sylvestris L. | Ref. |
Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
Plantae | Polygonaceae | Rheum emodi | Ref. |
Plantae | Polygonaceae | Rheum palmatum | Ref. |
Plantae | Polygonaceae | Rheum tanguticum | Ref. |
Plantae | Polygonaceae | Rumex patientia | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Rosaceae | Agrimonia pilosa var.japonica | Ref. |
Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
Plantae | Rosaceae | Crataegus monogyna calli | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus persica | Ref. |
Plantae | Rosaceae | Prunus tomentosa | Ref. |
Plantae | Rosaceae | Rosa amblyotis | Ref. |
Plantae | Rosaceae | Rosa cymosa | Ref. |
Plantae | Rosaceae | Rosa maximowicziana | Ref. |
Plantae | Rubiaceae | Uncaria gambir | Ref. |
Plantae | Rubiaceae | Uncaria lanosa | Ref. |
Plantae | Rutaceae | Euodia meliaefolia | Ref. |
Plantae | Salicaceae | Salix caprea | Ref. |
Plantae | Sapindaceae | Acer nikoense | Ref. |
Plantae | Sapotaceae | Manilkara zapota cv.Tikal | Ref. |
Plantae | Solanaceae | Solanum tuberosum subsp. Andigena | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Typhaceae | Typha capensis (Rohrb.) N. E. Br | Ref. |
Plantae | Ulmaceae | Ulmus pumila | Ref. |
Plantae | Vitaceae | Ampelopsis japonica | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zingiberaceae | Etlingera elatior | Ref. |
- | - | Actinida arguta | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Fugopyrum esculentum calli | Ref. |
- | - | Okoubaka aubrevillei | Ref. |
- | - | Rhei rhizoma | Ref. |
- | - | Scurrura atropurpurea | Ref. |
|
|
zoom in
Organism | Hippophae rhamnoides | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Heitzman, et al., Phytochemistry, 66, (2005), 5.
Chaubal, et al., Planta Med, 69, (2003), 287.
Takano, et al., Planta Med, 69, (2003), 321.
Demirezer, et al., Phytochemistry, 58, (2001), 1213.
Kinghorn, et al., Planta Med, 70, (2004), 691.
XIANG, et al., Chem Pharm Bull, 53, (2005), 1204.
KISHI, et al., Chem Pharm Bull, 51, (2003), 1051.
KANCHANAPOOM, et al., Chem Pharm Bull, 53, (2005), 579.
MORIKAWA, et al., Chem Pharm Bull, 51, (2003), 62.
OHASHI, et al., Chem Pharm Bull, 51, (2003), 343.
XIAO, et al., Chem Pharm Bull, 50, (2002), 605.
Dat, et al., Chem Pharm Bull, 53, (2005), 114.
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Zhang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 549. |
---|
|