Name |
p-Cymene 4-Cymene |
Formula |
C10H14 |
Mw |
134.10955045 |
CAS RN |
99-87-6 |
C_ID |
C00003040
, 
|
InChIKey |
HFPZCAJZSCWRBC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H14/c1-8(2)10-6-4-9(3)5-7-10/h4-8H,1-3H3 |
SMILES |
c1cc(ccc1C)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
Plantae | Annonaceae | Monodora myristica  | Ref. |
Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
Plantae | Annonaceae | Xylopia parviflora  | Ref. |
Plantae | Apiaceae | Angelica acutiloba  | Ref. |
Plantae | Apiaceae | Angelica acutiloba var.sugiyamae  | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
Plantae | Apiaceae | Carum copticum  | Ref. |
Plantae | Apiaceae | Cuminum cyminum  | Ref. |
Plantae | Apiaceae | Cuminum cyminum L.  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
Plantae | Aristolochiaceae | Aristolochia trilobata  | Ref. |
Plantae | Aristolochiaceae | Asarum heterotropoides var.mandsuricum | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
Plantae | Asteraceae | Achillea millefolium  | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Artemisia capillaris  | Ref. |
Plantae | Asteraceae | Artemisia scoparia. | Ref. |
Plantae | Asteraceae | Centaurea sessilis | Ref. |
Plantae | Asteraceae | Conyza newii  | Ref. |
Plantae | Asteraceae | Dittrichia graveolens  | Ref. |
Plantae | Asteraceae | Eupatorium fortunei  | Ref. |
Plantae | Asteraceae | Petasites albus  | Ref. |
Plantae | Asteraceae | Petasites hybridus  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Asteraceae | Saussurea lappa  | Ref. |
Plantae | Asteraceae | Senecio vulgaris  | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tanacetum vulgare  | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
Plantae | Chenopodiaceae | Chenopodium ambrosioides  | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cupressaceae | Juniperus rigida | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
Plantae | Fabaceae | Trifolium repens L.  | Ref. |
Plantae | Fagaceae | Quercus coccifera  | Ref. |
Plantae | Geraniaceae | Pelargonium capitatum  | Ref. |
Plantae | Geraniaceae | Pelargonium quercifolium  | Ref. |
Plantae | Geraniaceae | Pelargonium tomentosum  | Ref. |
Plantae | Labiatae | Agastache rugosus | Ref. |
Plantae | Labiatae | Lavandula angustifolia  | Ref. |
Plantae | Labiatae | Lavandula canarien-sis | Ref. |
Plantae | Labiatae | Lavandula gibsoni | Ref. |
Plantae | Labiatae | Lavandula latifolia  | Ref. |
Plantae | Labiatae | Lavandula multifida  | Ref. |
Plantae | Labiatae | Lavandula stoechas  | Ref. |
Plantae | Labiatae | Marrubium vulgare L.  | Ref. |
Plantae | Labiatae | Mentha arvensis L.  | Ref. |
Plantae | Labiatae | Mentha piperita L.  | Ref. |
Plantae | Labiatae | Mosla dianthera  | Ref. |
Plantae | Labiatae | Perilla frutescens var.arguta  | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Satureja thymbra  | Ref. |
Plantae | Labiatae | Schizonepeta tenuifolia  | Ref. |
Plantae | Labiatae | Tetradenia riparia  | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Labiatae | Thymus magnus | Ref. |
Plantae | Labiatae | Thymus piperella  | Ref. |
Plantae | Labiatae | Thymus quinquecostatus | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Labiatae | Trichostema lanceolatum | Ref. |
Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa  | Ref. |
Plantae | Lamiaceae | Coridothymus capitatus  | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens  | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Lauraceae | Ocotea veraguensis | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
Plantae | Meliaceae | Azadirachta indica  | Ref. |
Plantae | Meliaceae | Melia azadirach | Ref. |
Plantae | Myrtaceae | Eucalyptus aggregata | Ref. |
Plantae | Myrtaceae | Eucalyptus alba | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis  | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
Plantae | Myrtaceae | Eucalyptus deglupta  | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
Plantae | Myrtaceae | Eucalyptus gomphocephala | Ref. |
Plantae | Myrtaceae | Eucalyptus grandis  | Ref. |
Plantae | Myrtaceae | Eucalyptus microtheca  | Ref. |
Plantae | Myrtaceae | Eucalyptus nitens | Ref. |
Plantae | Myrtaceae | Eucalyptus robusta | Ref. |
Plantae | Myrtaceae | Eucalyptus saligna  | Ref. |
Plantae | Myrtaceae | Eucalyptus tereticornis  | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Oleaceae | Forsythia suspensa  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper arboreum  | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Piperaceae | Piper obliquum  | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rosaceae | Prunus armenica | Ref. |
Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
Plantae | Rutaceae | Citrus aurantium  | Ref. |
Plantae | Rutaceae | Citrus grandis  | Ref. |
Plantae | Rutaceae | Citrus hystrix  | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus paradisi  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Saururaceae | Houttuynia cordata  | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansii  | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis var.latifolia  | Ref. |
Plantae | Verbenaceae | Lantana camara  | Ref. |
Plantae | Verbenaceae | Lippia chevalieri | Ref. |
Plantae | Verbenaceae | Lippia multiflora  | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Zingiberaceae | Amomum medium | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza  | Ref. |
Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens  | Ref. |
- | - | Dicyclophora persica | Ref. |
- | - | Lavandin abrialis | Ref. |
- | - | Ulva pertusa | Ref. |
|
|
zoom in
Organism | Asarum sieboldii | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Shin, et al., Planta Med, 70, (2004), 1090.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
---|
|