| Name |
Kaempferol 3-O-rhamnoside
Afzelin
Kaempferol 3-O-alpha-rhamnoside
Kaempferol 3-O-alpha-L-rhamnopyranoside
Kaempferol-3-rhamnoside
Kaempherol 3-O-alpha-rhamnoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
482-39-3 |
| C_ID |
C00005140
, 
|
| InChIKey |
SOSLMHZOJATCCP-OVDJVLJZNA-N |
| InChICode |
InChI=1S/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15-,17+,18-,21-/m0/s1 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)C)c1ccc(cc1)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus parviflora  | Ref. |
| Plantae | Annonaceae | Annona purpurea | Ref. |
| Plantae | Annonaceae | Guatteria rupestris | Ref. |
| Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium | Ref. |
| Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
| Plantae | Betulaceae | Alnus japonica | Ref. |
| Plantae | Canellaceae | Warburgia stuhlmannii | Ref. |
| Plantae | Chenopodiaceae | Chenopodium murale | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus controversa | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
| Plantae | Cruciferae | Raphanus sativus | Ref. |
| Plantae | Cunoniaceae | Davidsonia pruriens | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Ephedraceae | Ephedra alata | Ref. |
| Plantae | Ephedraceae | Ephedra sinica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lunulata | Ref. |
| Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis | Ref. |
| Plantae | Euphorbiaceae | Mallotus metcalfianus | Ref. |
| Plantae | Fabaceae | Afzelia spp. | Ref. |
| Plantae | Fabaceae | Flemingia stricta | Ref. |
| Plantae | Fabaceae | Millettia zechiana | Ref. |
| Plantae | Fabaceae | Sindora siamensis | Ref. |
| Plantae | Geraniaceae | Geranium rotundifolium | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris spp. | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Labiatae | Ajuga remota | Ref. |
| Plantae | Lauraceae | Beilschmiedia miersii | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Loranthaceae | Dendrophthoe falcata | Ref. |
| Plantae | Loranthaceae | Hyphear tanakae | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Nymphaeaceae | Nymphaea odorata | Ref. |
| Plantae | Ochnaceae | Ochna beddomei | Ref. |
| Plantae | Onagraceae | Heterogaura heterandra | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Piperaceae | Piper umbellatum | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Polygalaceae | Polygala chinensis | Ref. |
| Plantae | Resedaceae | Ochradenus baccatus | Ref. |
| Plantae | Rosaceae | Agrimonia eupatoria | Ref. |
| Plantae | Rutaceae | Euodia alata | Ref. |
| Plantae | Rutaceae | Leptothyrsa sprucei | Ref. |
| Plantae | Rutaceae | Phellodendron amurense | Ref. |
| Plantae | Rutaceae | Zanthoxylum culantrillo | Ref. |
| Plantae | Saururaceae | Houttuynia cordata | Ref. |
| Plantae | Saxifragaceae | Heuchera spp. | Ref. |
| Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
| Plantae | Saxifragaceae | Rodgersia podophylla | Ref. |
| Plantae | Zingiberaceae | Zingiber aromaticum | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbet | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
| - | - | Tapirira guianensis | Ref. |
|
|
zoom in
| Organism | Ephedra sinica |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chi, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 233.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
KUROYANAGI, et al., Chem Pharm Bull, 53, (2005), 1519.
YUAN, et al., Chem Pharm Bull, 53, (2005), 1610.
Usia, et al., Journal of Natural Products, 65, (2002), 1079.
Chin, et al., Planta Med, 70, (2004), 576 |
|---|
|
