Name |
Naringenin chalcone Chalconaringenin Isosalipurpol trans-2',4,4',6'-Tetrahydroxychalcone (2E)- 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-2-Propen-1-one |
Formula |
C15H12O5 |
Mw |
272.06847349 |
CAS RN |
25515-46-2 |
C_ID |
C00007233
,
|
InChIKey |
YQHMWTPYORBCMF-ZZXKWVIFSA-N |
InChICode |
InChI=1S/C15H12O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-8,16-17,19-20H/b6-3+ |
SMILES |
c1(cc(c(c(c1)O)C(=O)/C=C/c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Cannabaceae | Cannabis indica | Ref. |
Plantae | Cannabaceae | Cannabis sativa | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica napus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca | Ref. |
Plantae | Liliaceae | Tulipa sp. | Ref. |
Plantae | Lythraceae | Punica granatum L. | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Salicaceae | Populus angustifolia | Ref. |
Plantae | Salicaceae | Populus sieboldii | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Petunia x hybrida | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Vitaceae | Vitis rupestris | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
Organism | Populus angustifolia | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
de Vlaming,Phytochem.,15,(1976),348
Wollenweber,Z.Naturforsch.C.,34,(1979),1289 |
---|
|