| Name |
Sinensetin
5,6,7,3',4'-Pentamethoxyflavone
Pedalitin permethyl ether
2-(3,4-Dimethoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C20H20O7 |
| Mw |
372.12090299 |
| CAS RN |
2306-27-6 |
| C_ID |
C00013596
, 
|
| InChIKey |
LKMNXYDUQXAUCZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(27-14)10-17(24-3)19(25-4)20(18)26-5/h6-10H,1-5H3 |
| SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1cc(c(cc1)OC)OC)OC)OC)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
| Plantae | Asteraceae | Chromolaena odorata | Ref. |
| Plantae | Asteraceae | Conoclinium coelestinum | Ref. |
| Plantae | Asteraceae | Eupatorium coelestinum | Ref. |
| Plantae | Chenopodiaceae | Chenopodium botrys | Ref. |
| Plantae | Chenopodiaceae | Chenopodium championii | Ref. |
| Plantae | Fabaceae | Bauhinia championii | Ref. |
| Plantae | Labiatae | Orthosiphon aristatus | Ref. |
| Plantae | Labiatae | Orthosiphon spicatus | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus | Ref. |
| Plantae | Plantaginaceae | Kickxia spuria | Ref. |
| Plantae | Rutaceae | Citrus auranthium | Ref. |
| Plantae | Rutaceae | Citrus aurantium | Ref. |
| Plantae | Rutaceae | Citrus grandis var.tomentosa | Ref. |
| Plantae | Rutaceae | Citrus reticulata | Ref. |
| Plantae | Rutaceae | Citrus sinensis | Ref. |
| Plantae | Rutaceae | Citrus tangerina | Ref. |
| Plantae | Rutaceae | Citrus tankan | Ref. |
| Plantae | Rutaceae | Murraya paniculata | Ref. |
| - | - | Clerodendranthus spicatus | Ref. |
|
|
zoom in
| Organism | Clerodendranthus spicatus |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Mizuno, et al., Chem Pharm Bull, 39, (1991), 945.
Zhong, et al., ABY, 6, (1984), 344.
Iimuma, et al., Chem Pharm Bull, 28, (1980), 717.
Chen, et al., Chem Pharm Bull, 32, (1984), 166.
Bishay, et al., Chem Abstr, 110, (1989), 92047m.
Vyas, et al., Phytochemistry, 25, (1986), 2625 |
|---|
|
