| Name |
Poncirin
Isosakuranetin-7-O-beta-D-neohesperidoside |
| Formula |
C28H34O14 |
| Mw |
594.1948558 |
| CAS RN |
14941-08-3 |
| C_ID |
C00000995
, 
|
| InChIKey |
NLAWPKPYBMEWIR-HHPLIBILNA-N |
| InChICode |
InChI=1S/C28H34O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-30,32-36H,9-10H2,1-2H3/t11-,17-,19-,21-,22+,23?,24-,25+,26-,27-,28+/m0/s1 |
| SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1ccc(cc1)OC)O)O[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lamiaceae | Acinos spp. | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
| Plantae | Rutaceae | Citrus grandis | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus sudachi | Ref. |
| Plantae | Rutaceae | Eremocitrus spp. | Ref. |
| Plantae | Rutaceae | Microcitrus spp. | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata | Ref. |
|
|
zoom in
| Organism | Citrus grandis |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Park, et al., Planta Med, 71, (2005), 24 |
|---|
|
