| Name |
Harmine |
| Formula |
C13H12N2O |
| Mw |
212.09496302 |
| CAS RN |
442-51-3 |
| C_ID |
C00001737
, 
|
| InChIKey |
BXNJHAXVSOCGBA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H12N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-7,15H,1-2H3 |
| SMILES |
c12c3c([nH]c1c(ncc2)C)cc(cc3)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cyperaceae | Carex brevicollis DC.  | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus angustifolia | Ref. |
| Plantae | Malpighiaceae | Banisteria caapi | Ref. |
| Plantae | Malpighiaceae | Banisteriopsis caapi spruce | Ref. |
| Plantae | Nitrariaceae | Peganum harmala | Ref. |
| Plantae | Nitrariaceae | Peganum nigellastrum | Ref. |
| Plantae | Oxalidaceae | Oxalis tuberosa Molina | Ref. |
| Plantae | Passifloraceae | Passiflora edulis | Ref. |
| Plantae | Passifloraceae | Passiflora incarnata | Ref. |
| Plantae | Rubiaceae | Psychotria viridis | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris L. | Ref. |
| Plantae | Zygophyllaceae | Zygophyllum fabago L. | Ref. |
| - | - | 7 species of butterflies | Ref. |
| - | - | Perganum harmala | Ref. |
| - | - | Simira rubra(Mart.)Steyerm. | Ref. |
|
|
zoom in
| Organism | Banisteria caapi |
|---|
| Reference | Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter20 |
|---|
|
