| Name |
Lobelanidine |
| Formula |
C22H29NO2 |
| Mw |
339.21982918 |
| CAS RN |
552-72-7 |
| C_ID |
C00002051
, 
|
| InChIKey |
OWGJQNXIWMMDTH-COPRSSIGNA-N |
| InChICode |
InChI=1S/C22H29NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-22,24-25H,8,13-16H2,1H3/t19-,20+,21-,22+ |
| SMILES |
c1cccc(c1)[C@@H](C[C@@H]1N([C@@H](CCC1)C[C@@H](c1ccccc1)O)C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Campanulaceae | Laurentia longiflora | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Isotoma longiflora  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia chinensis | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia hassleri | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia inflata | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia sessilifolia | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia urens | Ref. |
| Plantae | Crassulaceae | Sedum acre | Ref. |
| Plantae | Labiatae | Isodon longiflora | Ref. |
|
|
zoom in
| Organism | Lobelia chinensis |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
