| Name |
Procyanidin A2
Proanthocyanidin A-2
(+)-Proanthocyanidin A-2
Proanthocyanidin A2 |
| Formula |
C30H24O12 |
| Mw |
576.12677623 |
| CAS RN |
41743-41-3 |
| C_ID |
C00002934
, 
|
| InChIKey |
NSEWTSAADLNHNH-JIZSURFONA-N |
| InChICode |
InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26-,27-,29-,30+/m1/s1 |
| SMILES |
c1(cc(c2c(c1)O[C@@]1([C@@H]([C@H]2c2c3c(c(cc2O1)O)C[C@H]([C@H](O3)c1cc(c(cc1)O)O)O)O)c1cc(c(cc1)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Ecdysanthera utilis | Ref. |
| Plantae | Apocynaceae | Parameria laevigata MOLDENKE  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
| Plantae | Fabaceae | Arachis hypogaea L. | Ref. |
| Plantae | Lauraceae | Cinnamomum aromaticum | Ref. |
| Plantae | Lauraceae | Cinnamomum spp. | Ref. |
| Plantae | Lauraceae | Persea gratissima | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Malvaceae | Cola acuminata | Ref. |
| Plantae | Rosaceae | Malus sylvestris | Ref. |
| Plantae | Rosaceae | Rhaphiolepis umbellata | Ref. |
| Plantae | Rubiaceae | Pavetta owariensis | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
| - | - | Cinnamomi sp. | Ref. |
|
|
zoom in
| Organism | Garcinia mangostana |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Lou, et al., Phytochemistry, 51, (1999), 297.
Huang, et al., JNP, 64, (2001), 903 |
|---|
|
