Name |
Ledol (+)-Ledol |
Formula |
C15H26O |
Mw |
222.19836545 |
CAS RN |
577-27-5 |
C_ID |
C00003161
, 
|
InChIKey |
AYXPYQRXGNDJFU-MIBAWIEXNA-N |
InChICode |
InChI=1S/C15H26O/c1-9-5-6-10-12(9)13-11(14(13,2)3)7-8-15(10,4)16/h9-13,16H,5-8H2,1-4H3/t9-,10+,11-,12-,13+,15-/m1/s1 |
SMILES |
[C@@H]1([C@@H]2[C@H](CC1)[C@](CC[C@@H]1[C@@H]2C1(C)C)(C)O)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Xylopia sericea  | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
Plantae | Aristolochiaceae | Aristolochia indica  | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Ericaceae | Ledum columbianum | Ref. |
Plantae | Ericaceae | Ledum groenlandicum  | Ref. |
Plantae | Ericaceae | Ledum palustre  | Ref. |
Plantae | Fabaceae | Rhynchosia minima  | Ref. |
Plantae | Jubulaceae | Frullania tamarisci | Ref. |
Plantae | Meliaceae | Entandrophragma candolei | Ref. |
Plantae | Meliaceae | Entandrophragma cyclindricum | Ref. |
Plantae | Meliaceae | Entandrophragma utile | Ref. |
Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
Plantae | Myrtaceae | Psidium guajava  | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Piperaceae | Piper spp. | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
- | - | Lepicolea ochroleuca | Ref. |
|
|
zoom in
Organism | Aristolochia indica | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
---|
|