| Name |
Gardenin B
Demethyltangeretin
5-Hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
2798-20-1 |
| C_ID |
C00003883
, 
|
| InChIKey |
LXEVSYZNYDZSOB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)13-9-12(20)14-15(21)17(23-2)19(25-4)18(24-3)16(14)26-13/h5-9,21H,1-4H3 |
| SMILES |
c1(c(c(c2c(c1OC)oc(cc2=O)c1ccc(cc1)OC)O)OC)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis grisebachii | Ref. |
| Plantae | Asteraceae | Brickellia squarrosa | Ref. |
| Plantae | Asteraceae | Psiadia punctulata  | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Bignoniaceae | Godmania aesculifolia | Ref. |
| Plantae | Fabaceae | Ononis natrix | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Cunila fasciculata | Ref. |
| Plantae | Labiatae | Hyptis tomentosa | Ref. |
| Plantae | Labiatae | Mentha piperita | Ref. |
| Plantae | Labiatae | Mentha spp. | Ref. |
| Plantae | Labiatae | Mentha x citrata | Ref. |
| Plantae | Labiatae | Mentha x piperita | Ref. |
| Plantae | Labiatae | Nepeta transcaucasica | Ref. |
| Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton | Ref. |
| Plantae | Labiatae | Ocimum basilicum L. | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicum L. | Ref. |
| Plantae | Labiatae | Ocimum minimum L. | Ref. |
| Plantae | Labiatae | Ocimum selloi Benth. | Ref. |
| Plantae | Labiatae | Ocimum spp. | Ref. |
| Plantae | Labiatae | Ocimum tenuiflorum L. | Ref. |
| Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
| Plantae | Labiatae | Satureja montana | Ref. |
| Plantae | Labiatae | Sideritis jahandiezii | Ref. |
| Plantae | Rosaceae | Rosa centifolia | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
| Plantae | Rutaceae | Citrus jambhiri | Ref. |
| Plantae | Rutaceae | Citrus sinensis | Ref. |
| Plantae | Rutaceae | Citrus sinensis, | Ref. |
| Plantae | Tamaricaceae | Tamarix dioica | Ref. |
|
|
zoom in
| Organism | Psiadia punctulata |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Rama Rao,Indian J.Chem.,8,(1970),398
Kingston,J.Nat.Prod.,42,(1979),496 |
|---|
|
