Name |
Tamarixetin |
Formula |
C16H12O7 |
Mw |
316.05830274 |
CAS RN |
603-61-2 |
C_ID |
C00004636
,
|
InChIKey |
FPLMIPQZHHQWHN-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)OC)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Anethum graveolens | Ref. |
Plantae | Apiaceae | Levisticum officinale | Ref. |
Plantae | Apocynaceae | Thevetia neriifolia | Ref. |
Plantae | Asteraceae | Achyrocline flaccida | Ref. |
Plantae | Asteraceae | Ambrosia deltoidea | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Balsamorhiza macrophylla | Ref. |
Plantae | Asteraceae | Blumea balsamifera | Ref. |
Plantae | Asteraceae | Chromolaena odorata | Ref. |
Plantae | Betulaceae | Alnus glutinosa | Ref. |
Plantae | Capparaceae | Capparis spinosa | Ref. |
Plantae | Costaceae | Costus spicatus | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Fabaceae | Ceratonia siliqua | Ref. |
Plantae | Malvaceae | Gossypium hirsutum | Ref. |
Plantae | Polygonaceae | Rumex acetosa | Ref. |
Plantae | Rutaceae | Zanthoxylum bungeanum | Ref. |
Plantae | Tamaricaceae | Tamarix spp. | Ref. |
Plantae | Velloziaceae | Vellozia streptophylla | Ref. |
|
|
zoom in
Organism | Thevetia neriifolia | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Gupta,J.Chem.Soc.,(1954),3063 |
---|
|