| Name |
3,3'-Dimethylquercetin
Quercetin 3,3'-dimethyl ether
5,7,4'-Trihydroxy-3,3'-dimethoxyflavone
5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
4382-17-6 |
| C_ID |
C00004639
, 
|
| InChIKey |
FMEHGPQTMOPUGM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-12-5-8(3-4-10(12)19)16-17(23-2)15(21)14-11(20)6-9(18)7-13(14)24-16/h3-7,18-20H,1-2H3 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anarthriaceae | Anarthria scabra | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Centipeda minima | Ref. |
| Plantae | Asteraceae | Chrysothamnus humilis | Ref. |
| Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
| Plantae | Asteraceae | Pluchea sericea | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
| Plantae | Boraginaceae | Heliotropium sinuatum | Ref. |
| Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
| Plantae | Calceolariaceae | Calceolaria spp. | Ref. |
| Plantae | Capparaceae | Cleome amplyocarpa | Ref. |
| Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
| Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
| Plantae | Fabaceae | Acacia neovernicosa | Ref. |
| Plantae | Fabaceae | Astragalus alopecurus | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
| Plantae | Fabaceae | Prosopis fiebrigii | Ref. |
| Plantae | Fabaceae | Prosopis hassleri | Ref. |
| Plantae | Fouquieriacea | Fouquieria splendens | Ref. |
| Plantae | Labiatae | Salvia pedicellata | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus menziesii | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus nervosa | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Phrymaceae | Mimulus lewisii | Ref. |
| Plantae | Rosaceae | Cotoneaster microphylla | Ref. |
| Plantae | Rosaceae | Rubus phoenicolasius | Ref. |
| Plantae | Rutaceae | Barosma crenulata | Ref. |
| Plantae | Rutaceae | Melicope coodeana | Ref. |
| Plantae | Santalaceae | Viscum album | Ref. |
| Plantae | Santalaceae | Viscum cruciatum | Ref. |
|
|
zoom in
| Organism | Centipeda minima |
|---|
| Reference | Wu, et al., Chem Pharm Bull, 39, (1991), 3272.
Varga, et al., Fitoterapia, 53, (1982), 9.
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Jia, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 25, (1990), 758. |
|---|
|
