Name |
Robinin |
Formula |
C33H40O19 |
Mw |
740.2163791 |
CAS RN |
301-19-9,81992-85-0 |
C_ID |
C00005226
,
|
InChIKey |
PEFASEPMJYRQBW-LUUUVORTNA-N |
InChICode |
InChI=1S/C33H40O19/c1-10-19(36)23(40)26(43)31(47-10)46-9-17-21(38)25(42)28(45)33(51-17)52-30-22(39)18-15(35)7-14(49-32-27(44)24(41)20(37)11(2)48-32)8-16(18)50-29(30)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-28,31-38,40-45H,9H2,1-2H3/t10-,11+,17+,19-,20-,21-,23-,24-,25-,26-,27+,28+,31+,32-,33-/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)C)O)O)O)O)O)O)c1ccc(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)C)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apocynaceae | Rauvolfia verticillata | Ref. |
Plantae | Apocynaceae | Rhazya stricta | Ref. |
Plantae | Asteraceae | Senecio spp. | Ref. |
Plantae | Cactaceae | Cephalocereus senilis | Ref. |
Plantae | Dryopteridaceae | Dryopteris spp. | Ref. |
Plantae | Fabaceae | Astragalus falcatus | Ref. |
Plantae | Fabaceae | Astragalus shikokianus | Ref. |
Plantae | Fabaceae | Astragalus torrentum | Ref. |
Plantae | Fabaceae | Canavalia gladiata | Ref. |
Plantae | Fabaceae | Lathyrus spp. | Ref. |
Plantae | Fabaceae | Macroptilium spp. | Ref. |
Plantae | Fabaceae | Phaseolus spp. | Ref. |
Plantae | Fabaceae | Pueraria lobata | Ref. |
Plantae | Fabaceae | Robinia pseudoacacia | Ref. |
Plantae | Fabaceae | Vicia spp. | Ref. |
Plantae | Fabaceae | Vigna spp. | Ref. |
Plantae | Gentianaceae | Eustoma grandiflorum | Ref. |
Plantae | Liliaceae | Lilium regale | Ref. |
|
|
zoom in
Organism | Senecio spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Fakas,Phytochem.,15,(1976),215
Domon,Phytochem.,24,(1985),575 |
---|
|