Name |
Quercetin 3,7-O-beta-diglucopyranoside Quercetin 3,7-di-O-beta-D-glucopyranoside Quercetin 3,7-diglucoside |
Formula |
C27H30O17 |
Mw |
626.14829954 |
CAS RN |
6892-74-6 |
C_ID |
C00005427
, 
|
InChIKey |
BNSCASRSSGJHQH-AVNJKGJRNA-N |
InChICode |
InChI=1S/C27H30O17/c28-6-14-17(33)20(36)22(38)26(42-14)40-9-4-12(32)16-13(5-9)41-24(8-1-2-10(30)11(31)3-8)25(19(16)35)44-27-23(39)21(37)18(34)15(7-29)43-27/h1-5,14-15,17-18,20-23,26-34,36-39H,6-7H2/t14-,15-,17-,18-,20+,21-,22-,23-,26-,27+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona warmingiana | Ref. |
Plantae | Annonaceae | Guatteria australis | Ref. |
Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum  | Ref. |
Plantae | Celastraceae | Euonymus maackii | Ref. |
Plantae | Crassulaceae | Sedum acre  | Ref. |
Plantae | Cruciferae | Sisymbrium spp. | Ref. |
Plantae | Cucurbitaceae | Marah oreganus | Ref. |
Plantae | Equisetaceae | Equisetum laevigatum | Ref. |
Plantae | Fabaceae | Baptisia alba | Ref. |
Plantae | Fabaceae | Lotus polyphyllos | Ref. |
Plantae | Fabaceae | Macroptilium lathyroides | Ref. |
Plantae | Fabaceae | Ulex europaeus  | Ref. |
Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
Plantae | Geraniaceae | Geranium dissectum  | Ref. |
Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
Plantae | Orchidaceae | Brassia muricata | Ref. |
Plantae | Poaceae | Zea mays  | Ref. |
Plantae | Saxifragaceae | Heuchera micrantha | Ref. |
Plantae | Solanaceae | Leucophysalis spp. | Ref. |
Plantae | Solanaceae | Petunia x hybrida | Ref. |
Plantae | Solanaceae | Physalis alkekengi var. franchetii  | Ref. |
Plantae | Vitaceae | Vitis sp. | Ref. |
Plantae | Zygophyllaceae | Tribulus pentandrus | Ref. |
|
|
zoom in
Organism | Carthamus tinctorius | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Birkofer,Z.Naturforsch.B.,17,(1962),359
Farkas,Chem.Ber.,107,(1974),1518 |
---|
|