| Name |
Patuletin 7-glucoside |
| Formula |
C22H22O13 |
| Mw |
494.10604079 |
| CAS RN |
19833-25-1 |
| C_ID |
C00005644
, 
|
| InChIKey |
AFCDXKGLUDDXCK-LNFWJEHENA-N |
| InChICode |
InChI=1S/C22H22O13/c1-32-21-11(34-22-19(31)17(29)14(26)12(6-23)35-22)5-10-13(16(21)28)15(27)18(30)20(33-10)7-2-3-8(24)9(25)4-7/h2-5,12,14,17,19,22-26,28-31H,6H2,1H3/t12-,14-,17+,19-,22-/m1/s1 |
| SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)O)O)OC)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anthemis tinctoria  | Ref. |
| Plantae | Asteraceae | Centaurea solstitialis | Ref. |
| Plantae | Asteraceae | Chrysanthemum arcticum | Ref. |
| Plantae | Asteraceae | Chrysanthemum spp. | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Asteraceae | Coleostephus myconis | Ref. |
| Plantae | Asteraceae | Coreopsis nuecensoides | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Lagascea mollis | Ref. |
| Plantae | Asteraceae | Lepidophorum repandum | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla | Ref. |
| Plantae | Asteraceae | Neurolaena oaxacana | Ref. |
| Plantae | Asteraceae | Rudbeckia hirta | Ref. |
| Plantae | Asteraceae | Tagetes spp. | Ref. |
| Plantae | Fabaceae | Prosopis juliflora | Ref. |
| Plantae | Fabaceae | Prosopis spicigera | Ref. |
| - | - | Teragonotheca repanda | Ref. |
|
|
zoom in
| Organism | Chrysanthemum arcticum |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Sharma,Indian J.Chem.,2,(1964),83
El-Naggar,J.Nat.Prod.,42,(1979),126 |
|---|
|
