| Name |
Icariin |
| Formula |
C33H40O15 |
| Mw |
676.23672061 |
| CAS RN |
489-32-7 |
| C_ID |
C00005824
, 
|
| InChIKey |
TZJALUIVHRYQQB-QCAQYXAMNA-N |
| InChICode |
InChI=1S/C33H40O15/c1-13(2)5-10-17-19(45-33-28(42)26(40)23(37)20(12-34)46-33)11-18(35)21-24(38)31(48-32-27(41)25(39)22(36)14(3)44-32)29(47-30(17)21)15-6-8-16(43-4)9-7-15/h5-9,11,14,20,22-23,25-28,32-37,39-42H,10,12H2,1-4H3/t14-,20+,22-,23+,25+,26-,27-,28+,32-,33+/m0/s1 |
| SMILES |
c1(cc(c2c(c1CC=C(C)C)oc(c(c2=O)O[C@@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)C)c1ccc(cc1)OC)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Berberidaceae | Epimedium spp. | Ref. |
| Plantae | Berberidaceae | Vancouveria hexandra | Ref. |
|
|
zoom in
| Organism | Vancouveria hexandra |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Tokuoka,Yakugaku Zasshi,95,(1975),825
Mizuno,Phytochem.,27,(1988),3645 |
|---|
|
