| Name |
7,4'''-Di-O-Methylagathisflavone |
| Formula |
C32H22O10 |
| Mw |
566.12129692 |
| CAS RN |
28441-99-8 |
| C_ID |
C00006454
, 
|
| InChIKey |
DBTOGCSZILHERQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C32H22O10/c1-39-18-9-5-16(6-10-18)24-12-21(36)27-19(34)11-20(35)29(32(27)42-24)30-25(40-2)14-26-28(31(30)38)22(37)13-23(41-26)15-3-7-17(33)8-4-15/h3-14,33-35,38H,1-2H3 |
| SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)c1c(cc(c2c1oc(cc2=O)c1ccc(cc1)OC)O)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Agathis alba | Ref. |
| Plantae | Araucariaceae | Agathis dammara | Ref. |
| Plantae | Araucariaceae | Agathis palmerstoni | Ref. |
| Plantae | Araucariaceae | Araucaria columnaris | Ref. |
|
|
zoom in
| Organism | Agathis palmerstoni |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Pelter,Experietia,25,(1969),351 |
|---|
|
