| Name |
Heveaflavone |
| Formula |
C33H24O10 |
| Mw |
580.13694699 |
| CAS RN |
23132-13-0 |
| C_ID |
C00006498
, 
|
| InChIKey |
NXPAGAZHSWSUFJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C33H24O10/c1-39-18-7-4-16(5-8-18)26-14-24(37)32-25(38)15-28(41-3)30(33(32)43-26)20-10-17(6-9-21(20)34)27-13-23(36)31-22(35)11-19(40-2)12-29(31)42-27/h4-15,34-35,38H,1-3H3 |
| SMILES |
c1c(c(ccc1c1oc2c(c(=O)c1)c(cc(c2)OC)O)O)c1c(cc(c2c1oc(cc2=O)c1ccc(cc1)OC)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Hevea brasiliensis  | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Podocarpaceae | Podocarpus latifolius | Ref. |
|
|
zoom in
| Organism | Podocarpus latifolius |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Madhav,Tetrahedron Lett.,(1969),2017
Chandramouli,Indian J.Chem.,9,(1971),895 |
|---|
|
