| Name |
Fisetinidol-(4alpha->6)-catechin |
| Formula |
C30H26O11 |
| Mw |
562.14751167 |
| CAS RN |
69176-55-2 |
| C_ID |
C00009135
, 
|
| InChIKey |
SESBFFBADRRLTM-DMEURUTQNA-N |
| InChICode |
InChI=1S/C30H26O11/c31-14-3-4-15-23(9-14)41-30(13-2-6-18(33)20(35)8-13)28(39)25(15)26-21(36)11-24-16(27(26)38)10-22(37)29(40-24)12-1-5-17(32)19(34)7-12/h1-9,11,22,25,28-39H,10H2/t22-,25-,28-,29+,30+/m0/s1 |
| SMILES |
c1c(ccc(c1O)O)[C@H]1Oc2c(C[C@@H]1O)c(c(c(c2)O)[C@H]1[C@@H]([C@H](Oc2c1ccc(c2)O)c1ccc(c(c1)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Baikiaea plurijuga | Ref. |
| Plantae | Fabaceae | Guibourtia coleosperma  | Ref. |
| Plantae | Fabaceae | Prosopis glandulosa | Ref. |
|
|
zoom in
| Organism | Prosopis glandulosa |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Steynberg,J.Chem.Soc.Perkin Trans,1,(1988),3323 |
|---|
|
