| Name |
Biochanin A 7-O-xylosyl-(1->6)-glucoside
Kakkanin |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
63770-91-2 |
| C_ID |
C00010115
, 
|
| InChIKey |
ODHKRSFJWQEWGG-YLADPVBGNA-N |
| InChICode |
InChI=1S/C27H30O14/c1-36-12-4-2-11(3-5-12)14-8-37-17-7-13(6-15(28)19(17)20(14)30)40-27-25(35)23(33)22(32)18(41-27)10-39-26-24(34)21(31)16(29)9-38-26/h2-8,16,18,21-29,31-35H,9-10H2,1H3/t16-,18+,21+,22-,23+,24+,25-,26-,27-/m1/s1 |
| SMILES |
O(c1cc2c(c(=O)c(co2)c2ccc(cc2)OC)c(c1)O)[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO[C@@H]1[C@H]([C@H]([C@@H](CO1)O)O)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
| Plantae | Fabaceae | Sophora japonica | Ref. |
|
|
zoom in
| Organism | Sophora japonica |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Takeda,Phytochem.,16,(1977),619 |
|---|
|
