| Name |
Cytochalasin A |
| Formula |
C29H35NO5 |
| Mw |
477.25152324 |
| CAS RN |
14110-64-6 |
| C_ID |
C00011321
, 
|
| InChIKey |
ZMAODHOXRBLOQO-OYLJOZLTNA-N |
| InChICode |
InChI=1S/C29H35NO5/c1-18-9-7-13-22(31)15-16-25(32)35-29-23(14-8-10-18)27(33)20(3)19(2)26(29)24(30-28(29)34)17-21-11-5-4-6-12-21/h4-6,8,11-12,14-16,18-19,23-24,26-27,33H,3,7,9-10,13,17H2,1-2H3,(H,30,34)/b14-8+,16-15+/t18-,19-,23-,24+,26+,27-,29-/m1/s1 |
| SMILES |
c1cc(ccc1)C[C@@H]1NC(=O)[C@]23OC(=O)/C=C/C(=O)CCC[C@H](C/C=C/[C@@H]3[C@@H](C(=C)[C@H]([C@@H]12)C)O)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Incertae sedis | Ascochyta heteromorpha | Ref. |
| Fungi | Incertae sedis | Phoma exigua var. exigua | Ref. |
| Fungi | Pleosporaceae | Helminthosporium dematioideum | Ref. |
|
|
zoom in
| Organism | Helminthosporium dematioideum |
|---|
| Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),276
Nator,Mycotoxins and Phytoalexins,(1991),291 |
|---|
|
