Name |
Coptisine YHL II |
Formula |
C19H14NO4 |
Mw |
320.09228294 |
CAS RN |
3486-66-6 |
C_ID |
C00024668
, 
|
InChIKey |
XYHOBCMEDLZUMP-UHFFFAOYSA-N |
InChICode |
InChI=1S/C19H14NO4/c1-2-16-19(24-10-21-16)14-8-20-4-3-12-6-17-18(23-9-22-17)7-13(12)15(20)5-11(1)14/h1-2,5-8H,3-4,9-10H2/q+1 |
SMILES |
c1c2c(c3c(c1)cc1[n+](c3)CCc3c1cc1c(c3)OCO1)OCO2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Berberidaceae | Mahonia japonica | Ref. |
Plantae | Berberidaceae | Nandina domestica  | Ref. |
Plantae | Fumariaceae | Corydalis adunca | Ref. |
Plantae | Fumariaceae | Corydalis ambigua var.amurensis  | Ref. |
Plantae | Fumariaceae | Corydalis cava (L.) Schw.et Koert  | Ref. |
Plantae | Fumariaceae | Corydalis dasypterma | Ref. |
Plantae | Fumariaceae | Corydalis decumbens  | Ref. |
Plantae | Fumariaceae | Corydalis incisa | Ref. |
Plantae | Fumariaceae | Corydalis intermedia | Ref. |
Plantae | Fumariaceae | Corydalis ledebouriana | Ref. |
Plantae | Fumariaceae | Corydalis longicalcarata | Ref. |
Plantae | Fumariaceae | Corydalis nobilis | Ref. |
Plantae | Fumariaceae | Corydalis ophiocarpa Thoms | Ref. |
Plantae | Fumariaceae | Corydalis pallida | Ref. |
Plantae | Fumariaceae | Corydalis remota | Ref. |
Plantae | Fumariaceae | Corydalis repens | Ref. |
Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
Plantae | Fumariaceae | Dicentra spectabilis | Ref. |
Plantae | Fumariaceae | Fumaria agraria | Ref. |
Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
Plantae | Fumariaceae | Fumaria densiflora DC | Ref. |
Plantae | Fumariaceae | Fumaria judaica Boiss | Ref. |
Plantae | Fumariaceae | Fumaria kraliki Jordan | Ref. |
Plantae | Fumariaceae | Fumaria muralis | Ref. |
Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
Plantae | Fumariaceae | Fumaria parviflora Lam.  | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
Plantae | Fumariaceae | Hypecoum japonicum | Ref. |
Plantae | Fumariaceae | Hypecoum leptocarpum  | Ref. |
Plantae | Papaveraceae | Chelidonium major  | Ref. |
Plantae | Papaveraceae | Chelidonium majus L.  | Ref. |
Plantae | Papaveraceae | Dicranostigma lactucoides Hook f.et.Thoms  | Ref. |
Plantae | Papaveraceae | Dicranostigma leptodum (Maxim.) Fedde | Ref. |
Plantae | Papaveraceae | Glaucium arabicum | Ref. |
Plantae | Papaveraceae | Hunnemannia fumariaefolia Sweet | Ref. |
Plantae | Papaveraceae | Meconopsis robusta | Ref. |
Plantae | Papaveraceae | Papaver albiflora | Ref. |
Plantae | Papaveraceae | Papaver albiflorum sub.spp.albiflorum | Ref. |
Plantae | Papaveraceae | Papaver albiflorum sub.spp.austromoravicum | Ref. |
Plantae | Papaveraceae | Papaver argemone | Ref. |
Plantae | Papaveraceae | Papaver confine Jord. | Ref. |
Plantae | Papaveraceae | Papaver lecoquii Lamotte | Ref. |
Plantae | Papaveraceae | Papaver orientale  | Ref. |
Plantae | Papaveraceae | Papaver pseudoorientale (Fedde) Medw. | Ref. |
Plantae | Papaveraceae | Papaver rhoeas L.  | Ref. |
Plantae | Papaveraceae | Papaver rhoeas chelidonides  | Ref. |
Plantae | Papaveraceae | Papaver rhopalothece | Ref. |
Plantae | Papaveraceae | Papaver rupifragum Boss et.Reut | Ref. |
Plantae | Papaveraceae | Papaver setigerum | Ref. |
Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
Plantae | Ranunculaceae | Coptis chinensis  | Ref. |
Plantae | Ranunculaceae | Coptis chinensis var.brevisepala  | Ref. |
Plantae | Ranunculaceae | Coptis deltoidea  | Ref. |
Plantae | Ranunculaceae | Coptis groenlandica | Ref. |
Plantae | Ranunculaceae | Coptis gulinensis | Ref. |
Plantae | Ranunculaceae | Coptis japonica  | Ref. |
Plantae | Ranunculaceae | Coptis linearisepala | Ref. |
Plantae | Ranunculaceae | Coptis omeiensis | Ref. |
Plantae | Ranunculaceae | Coptis quinquefolia Miq. | Ref. |
Plantae | Ranunculaceae | Coptis teetoides | Ref. |
Plantae | Ranunculaceae | Thalictrum atriplex | Ref. |
Plantae | Ranunculaceae | Thalictrum faberi | Ref. |
Plantae | Ranunculaceae | Thalictrum foliolosum  | Ref. |
Plantae | Ranunculaceae | Thalictrum glandulosissimum | Ref. |
Plantae | Ranunculaceae | Thalictrum microgynum | Ref. |
Plantae | Ranunculaceae | Thalictrum minus | Ref. |
Plantae | Ranunculaceae | Thalictrum petaloideum | Ref. |
Plantae | Ranunculaceae | Thalictrum simplex | Ref. |
Plantae | Ranunculaceae | Thalictrum thunbergii | Ref. |
- | - | Chelidonum majus | Ref. |
- | - | Papver stevenianum | Ref. |
|
|
zoom in
Organism | Corydalis adunca | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
---|
|