| Name |
Quinidine
(+)-Quinidine |
| Formula |
C20H24N2O2 |
| Mw |
324.18377802 |
| CAS RN |
56-54-2 |
| C_ID |
C00031117
, 
|
| InChIKey |
LOUPRKONTZGTKE-YNHRJVTQNA-N |
| InChICode |
InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19+,20-/m0/s1 |
| SMILES |
c1cc2c(cc1OC)c(ccn2)[C@@H]([C@@H]1N2C[C@@H]([C@H](C1)CC2)C=C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Diaporthaceae | Diaporthe sp. CLF-J | Ref. |
| Plantae | Apocynaceae | Aspidosperma marcgravianum L. | Ref. |
| Plantae | Rubiaceae | Cinchona ledgariana | Ref. |
| Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
| Plantae | Rubiaceae | Cinchona officinalis  | Ref. |
| Plantae | Rubiaceae | Cinchona pubescens | Ref. |
| Plantae | Rubiaceae | Cinchona robusta | Ref. |
| Plantae | Rubiaceae | Cinchona sp. | Ref. |
| Plantae | Rubiaceae | Cinchona spp. | Ref. |
| Plantae | Rubiaceae | Remijia pedunculata | Ref. |
|
|
zoom in
| Organism | Cinchona ledgariana |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
SUBEHAN, et al., Chem Pharm Bull, 53, (2005), 333.
Usia, et al., JNP, 68, (2005), 64 |
|---|
|
