| Name |
Myrtenol |
| Formula |
C10H16O |
| Mw |
152.12011513 |
| CAS RN |
515-00-4 |
| C_ID |
C00037531
, 
|
| InChIKey |
RXBQNMWIQKOSCS-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C10H16O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3/t8-,9-/m1/s1 |
| SMILES |
C1([C@@H]2CC=C([C@H]1C2)CO)(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
| Plantae | Cupressaceae | Callitris neocaledonica | Ref. |
| Plantae | Cupressaceae | Neocallitropsis pancheri | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
| Plantae | Labiatae | Lavandula angustifolia | Ref. |
| Plantae | Labiatae | Lavandula dentata | Ref. |
| Plantae | Labiatae | Lavandula stoechas | Ref. |
| Plantae | Labiatae | Mentha arvensis L. | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Labiatae | Satureja hortensis | Ref. |
| Plantae | Labiatae | Satureja subspicata | Ref. |
| Plantae | Myrtaceae | Myrtus communis | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
| Plantae | Piperaceae | Piper nigrum | Ref. |
| Plantae | Poaceae | Cymbopogon citratus | Ref. |
| Plantae | Zingiberaceae | Curcuma aeruginosa | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga | Ref. |
| - | - | Baeckea frutescens L. | Ref. |
|
|
zoom in
| Organism | Bupleurum chinense |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Gao, et al., Xinyao yu Linchuang, 4, (1985), 15.
Chem Abstr, 102, (1985), 106018b |
|---|
|
