| Name |
Carvacrol |
| Formula |
C10H14O |
| Mw |
150.10446507 |
| CAS RN |
499-75-2 |
| C_ID |
C00000156
, 
|
| InChIKey |
RECUKUPTGUEGMW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
| SMILES |
c1cc(cc(c1C)O)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cyprinidae | Orthodon hadai | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Angelica sinensis | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia annua | Ref. |
| Plantae | Asteraceae | Baccharis dracunculifolia | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
| Plantae | Burseraceae | Canarium album | Ref. |
| Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
| Plantae | Gentianaceae | Gentiana lutea | Ref. |
| Plantae | Labiatae | Mosla chinensis | Ref. |
| Plantae | Labiatae | Origanum vulgare | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Labiatae | Satureja thymbra | Ref. |
| Plantae | Labiatae | Thymus capitatus | Ref. |
| Plantae | Labiatae | Thymus magnus | Ref. |
| Plantae | Labiatae | Thymus piperella | Ref. |
| Plantae | Labiatae | Thymus pubescens | Ref. |
| Plantae | Labiatae | Thymus quinquecostatus | Ref. |
| Plantae | Labiatae | Thymus vulgaris | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa | Ref. |
| Plantae | Lamiaceae | Coridothymus capitatus | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lauraceae | Ocotea corymbosa | Ref. |
| Plantae | Piperaceae | Piper betle | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L | Ref. |
| Plantae | Rutaceae | Citrus reticulata | Ref. |
| Plantae | Saururaceae | Houttuynia cordata | Ref. |
| Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
| Plantae | Verbenaceae | Lippia chevalieri | Ref. |
| - | - | Baeckea frutescens L. | Ref. |
| - | - | Labiatae | Ref. |
| - | - | Origanum | Ref. |
| - | - | Thyme | Ref. |
| - | - | Trachyspermum roxburghianum | Ref. |
|
|
zoom in
| Organism | Thymus quinquecostatus |
|---|
| Reference | Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Shin, et al., Planta Med, 70, (2004), 1090.
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|
