Name |
Liquiritigenin |
Formula |
C15H12O4 |
Mw |
256.07355887 |
CAS RN |
578-86-9 |
C_ID |
C00000977
, 
|
InChIKey |
FURUXTVZLHCCNA-YQTOOIBONA-N |
InChICode |
InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2/t14-/m0/s1 |
SMILES |
c1(ccc2c(c1)O[C@@H](CC2=O)c1ccc(cc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaryllidaceae | Crinum bulbispermum Milne | Ref. |
Plantae | Amaryllidaceae | Pancratium maritimum L. | Ref. |
Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Dracaenaceae | Dracaena draco  | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Bauhinia guianensis  | Ref. |
Plantae | Fabaceae | Centrolobium robustum | Ref. |
Plantae | Fabaceae | Cicer arietinum  | Ref. |
Plantae | Fabaceae | Dalbergia ecastaphyllum  | Ref. |
Plantae | Fabaceae | Dalbergia latifolia  | Ref. |
Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
Plantae | Fabaceae | Dalbergia sissoides  | Ref. |
Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
Plantae | Fabaceae | Diplotropis purpurea | Ref. |
Plantae | Fabaceae | Echinosophora koreensis | Ref. |
Plantae | Fabaceae | Erythrina fusca  | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Glycyrrhiza echinata  | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
Plantae | Fabaceae | Medicago lupulina  | Ref. |
Plantae | Fabaceae | Medicago sativa  | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Melilotus altissimus  | Ref. |
Plantae | Fabaceae | Melilotus dentatus | Ref. |
Plantae | Fabaceae | Melilotus elegans | Ref. |
Plantae | Fabaceae | Melilotus infestus | Ref. |
Plantae | Fabaceae | Melilotus italica | Ref. |
Plantae | Fabaceae | Melilotus messanensis | Ref. |
Plantae | Fabaceae | Melilotus neapolitanus | Ref. |
Plantae | Fabaceae | Melilotus officinalis subsp. suaveolens  | Ref. |
Plantae | Fabaceae | Melilotus polonicus | Ref. |
Plantae | Fabaceae | Melilotus tauricus | Ref. |
Plantae | Fabaceae | Melilotus wolgicus | Ref. |
Plantae | Fabaceae | Onobrychis sp. | Ref. |
Plantae | Fabaceae | Onobrychis viciifolia Scop.  | Ref. |
Plantae | Fabaceae | Peltogyne paniculata | Ref. |
Plantae | Fabaceae | Peltogyne sp. | Ref. |
Plantae | Fabaceae | Peltogyne venosa | Ref. |
Plantae | Fabaceae | Pericopsis elata  | Ref. |
Plantae | Fabaceae | Pericopsis mooniana | Ref. |
Plantae | Fabaceae | Pisum sativum  | Ref. |
Plantae | Fabaceae | Pterocarpus angolensis  | Ref. |
Plantae | Fabaceae | Pterocarpus macrocarpus | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
Plantae | Fabaceae | Pueraria lobata  | Ref. |
Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
Plantae | Fabaceae | Sophora flavescens  | Ref. |
Plantae | Fabaceae | Sophora gypsophila | Ref. |
Plantae | Fabaceae | Sophora secundiflora  | Ref. |
Plantae | Fabaceae | Spatholobus suberectus Dunn  | Ref. |
Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
Plantae | Fabaceae | Umtiza listerana | Ref. |
Plantae | Moraceae | Brosimum acutifolium  | Ref. |
Plantae | Rutaceae | Clausena excavata  | Ref. |
Plantae | Solanaceae | Datura innoxia  | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
- | - | Moghania philippinensis | Ref. |
|
|
zoom in
Organism | Glycyrrhiza inflata | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Li, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 30, (1995), 455.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11
Yang,Acta Bot. Sin.,30,(198),176 |
---|
|