Name |
Dihydrochrysin Pinocembrin |
Formula |
C15H12O4 |
Mw |
256.07355887 |
CAS RN |
480-39-7 |
C_ID |
C00000992
,
|
InChIKey |
URFCJEUYXNAHFI-UGPWUYPHNA-N |
InChICode |
InChI=1S/C15H12O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-7,13,16-17H,8H2/t13-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1ccccc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Anomianthus dulcis | Ref. |
Plantae | Annonaceae | Goniothalamus griffithii | Ref. |
Plantae | Annonaceae | Uvaria chamae | Ref. |
Plantae | Asteraceae | Flourensia hirsuta | Ref. |
Plantae | Asteraceae | Flourensia ilicifolia | Ref. |
Plantae | Asteraceae | Flourensia retinophylla | Ref. |
Plantae | Asteraceae | Helichrysum forskahlii | Ref. |
Plantae | Asteraceae | Helichrysum italicum | Ref. |
Plantae | Asteraceae | Helichrysum spp. | Ref. |
Plantae | Asteraceae | Phonus arborescens | Ref. |
Plantae | Betulaceae | Alnus spp. | Ref. |
Plantae | Combretaceae | Combretum albopunctatum Suesseng | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Scutellaria spp. | Ref. |
Plantae | Lauraceae | Litsea glaucescens | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Moraceae | Broussonetia papyrifera | Ref. |
Plantae | Myrtaceae | Eucalyptus spp. | Ref. |
Plantae | Myrtaceae | Syzygium samarangense | Ref. |
Plantae | Pinaceae | Pinus cembra | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
Plantae | Piperaceae | Piper gaudichaudianum | Ref. |
Plantae | Piperaceae | Piper hostmannianum | Ref. |
Plantae | Rosaceae | Prunus spp. | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Salicaceae | Populus spp. | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF. | Ref. |
|
|
zoom in
Organism | Eucalyptus spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 229,Flavanones and dihydroflavonols
Lindstedt,Acta Chem.Scand.,5,(1951),129
Wollenweber,Phytochem.,10,(1971),225 |
---|
|