Name |
Retamine |
Formula |
C15H26N2O |
Mw |
250.20451347 |
CAS RN |
2122-29-4 |
C_ID |
C00002233
,
|
InChIKey |
JMXNBIDTNISOTA-IPSOCRMYNA-N |
InChICode |
InChI=1S/C15H26N2O/c18-14-5-3-7-17-9-11-8-12(15(14)17)10-16-6-2-1-4-13(11)16/h11-15,18H,1-10H2/t11-,12-,13-,14-,15-/m0/s1 |
SMILES |
C1CCN2[C@@H](C1)[C@H]1C[C@@H](C2)[C@@H]2N(C1)CCC[C@@H]2O |
Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Convolvulaceae | Cuscuta palaestina | Ref. |
Plantae | Fabaceae | Anagyris foetida | Ref. |
Plantae | Fabaceae | Cytisus balansae | Ref. |
Plantae | Fabaceae | Cytisus villosus | Ref. |
Plantae | Fabaceae | Echinospartum horridum | Ref. |
Plantae | Fabaceae | Genista acanthoclada | Ref. |
Plantae | Fabaceae | Genista cinerea | Ref. |
Plantae | Fabaceae | Genista corsica | Ref. |
Plantae | Fabaceae | Genista germanica | Ref. |
Plantae | Fabaceae | Genista junceum | Ref. |
Plantae | Fabaceae | Genista pilosa | Ref. |
Plantae | Fabaceae | Genista radiata | Ref. |
Plantae | Fabaceae | Genista sphaerocarpa | Ref. |
Plantae | Fabaceae | Genista sylvestris | Ref. |
Plantae | Fabaceae | Genista tejedensis | Ref. |
Plantae | Fabaceae | Genista tinctoria | Ref. |
Plantae | Fabaceae | Genista triacanthos | Ref. |
Plantae | Fabaceae | Genista tridentata | Ref. |
Plantae | Santalaceae | Viscum cruciatum | Ref. |
- | - | Lygos raetam | Ref. |
- | - | family Fabaceae spp. | Ref. |
|
|
zoom in
Organism | family Fabaceae spp. | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
---|
|