Name |
Rhamnetin 3,5,3',4'-Tetrahydroxy-7-methoxyflavone 7-Methoxyquercetin 2-(3,4-Dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1- benzopyran-4-one 7-O-Methxyl quercetin Rhamnose |
Formula |
C16H12O7 |
Mw |
316.05830274 |
CAS RN |
90-19-7 |
C_ID |
C00004634
,
|
InChIKey |
JGUZGNYPMHHYRK-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Anthemis altissima | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia campestris ssp. glutinosa | Ref. |
Plantae | Asteraceae | Artemisia glutinosa | Ref. |
Plantae | Asteraceae | Baccharis pilularis | Ref. |
Plantae | Asteraceae | Blumea balsamifera | Ref. |
Plantae | Asteraceae | Cassinia vauvilliersii | Ref. |
Plantae | Asteraceae | Centaurea collina L. | Ref. |
Plantae | Asteraceae | Chromolaena meridensis | Ref. |
Plantae | Asteraceae | Chromolaena odorata | Ref. |
Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
Plantae | Asteraceae | Flourensia thurifera | Ref. |
Plantae | Asteraceae | Madia elegans | Ref. |
Plantae | Asteraceae | Ozothamnus expansifolius | Ref. |
Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
Plantae | Asteraceae | Pulicaria dysenterica | Ref. |
Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
Plantae | Capparaceae | Capparis tweediana | Ref. |
Plantae | Crassulaceae | Aeonium spp. | Ref. |
Plantae | Cruciferae | Erysimum carniolicum | Ref. |
Plantae | Dilleniaceae | Dillenia spp. | Ref. |
Plantae | Dilleniaceae | Tetracera asiatica | Ref. |
Plantae | Dilleniaceae | Tetracera spp. | Ref. |
Plantae | Fabaceae | Acacia ixiophylla | Ref. |
Plantae | Labiatae | Meehania urticifolia | Ref. |
Plantae | Labiatae | Pogostemon cablin | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa pterygosperma | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus obliqua | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Rhamnaceae | Rhamnus cathartica | Ref. |
Plantae | Salicaceae | Populus nigra | Ref. |
Plantae | Santalaceae | Viscum album | Ref. |
Plantae | Santalaceae | Viscum cruciatum | Ref. |
Plantae | Smilacaceae | Smilax riparia | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Velloziaceae | Vellozia streptophylla | Ref. |
Plantae | Zamiaceae | Apis mellifera ligustica | Ref. |
|
|
zoom in
Organism | Dillenia spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Perkin,J.Chem.Soc.,67,(1895),500
Wollenweber,Z.Naturforsch.C.,42,(1987),1030 |
---|
|