Name |
Delphinidin 3-(6''-malonylglucoside) |
Formula |
C24H23O15 |
Mw |
551.10369507 |
CAS RN |
122856-09-1 |
C_ID |
C00006877
,
|
InChIKey |
FNFHDAUGLIPVPU-SSQULFQMNA-O |
InChICode |
InChI=1S/C24H22O15/c25-9-3-11(26)10-5-15(23(37-14(10)4-9)8-1-12(27)19(32)13(28)2-8)38-24-22(35)21(34)20(33)16(39-24)7-36-18(31)6-17(29)30/h1-5,16,20-22,24,33-35H,6-7H2,(H5-,25,26,27,28,29,30,32)/p+1/t16-,20-,21+,22-,24-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)CC(=O)O)O)O)O)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Fabaceae | Clitoria ternatea | Ref. |
Plantae | Fabaceae | Lupinus spp. | Ref. |
Plantae | Malvaceae | Hibiscus syriacus | Ref. |
Plantae | Passifloraceae | Passiflora suberosa | Ref. |
Plantae | Poaceae | Alopecurus spp. | Ref. |
Plantae | Poaceae | Anthoxanthum spp. | Ref. |
Plantae | Poaceae | Avenula spp. | Ref. |
Plantae | Poaceae | Bothriochloa spp. | Ref. |
Plantae | Poaceae | Dactylis spp. | Ref. |
Plantae | Poaceae | Deschampsia spp. | Ref. |
Plantae | Poaceae | Elymus spp. | Ref. |
Plantae | Poaceae | Festuca spp. | Ref. |
Plantae | Poaceae | Hordeum spp. | Ref. |
Plantae | Poaceae | Miscanthus spp. | Ref. |
Plantae | Poaceae | Molinia spp. | Ref. |
Plantae | Poaceae | Oryza spp. | Ref. |
Plantae | Poaceae | Phalaris spp. | Ref. |
Plantae | Poaceae | Phleum spp. | Ref. |
Plantae | Poaceae | Poa spp. | Ref. |
Plantae | Poaceae | Sinarundinaria spp. | Ref. |
Plantae | Verbenaceae | Verbena x hybrida | Ref. |
|
|
zoom in
Organism | Verbena x hybrida | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Kim,Phytochem.,28,(1989),1503
Terahara,Phytochem.,28,(1989),1507 |
---|
|