Name |
Procyanidin B5 Epicatechin-(4beta-6)-epicatechin |
Formula |
C30H26O12 |
Mw |
578.1424263 |
CAS RN |
12798-57-1 |
C_ID |
C00009076
,
|
InChIKey |
GMISZFQPFDAPGI-CHOHJSMINA-N |
InChICode |
InChI=1S/C30H26O12/c31-13-7-19(36)24-23(8-13)42-30(12-2-4-16(33)18(35)6-12)28(40)26(24)25-20(37)10-22-14(27(25)39)9-21(38)29(41-22)11-1-3-15(32)17(34)5-11/h1-8,10,21,26,28-40H,9H2/t21-,26+,28-,29-,30-/m1/s1 |
SMILES |
c1c(ccc(c1O)O)[C@H]1Oc2c(C[C@H]1O)c(c(c(c2)O)[C@H]1[C@H]([C@H](Oc2c1c(cc(c2)O)O)c1ccc(c(c1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana | Ref. |
Plantae | Davalliaceae | Davallia mariesii | Ref. |
Plantae | Dioscoreaceae | Dioscorea cirrhosa | Ref. |
Plantae | Ericaceae | Calluna vulgaris | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Fabaceae | Campylotropis hirella | Ref. |
Plantae | Lauraceae | Cinnamomum bejolghota | Ref. |
Plantae | Lauraceae | Cinnamomum cassia Blume. | Ref. |
Plantae | Lauraceae | Cinnamomum obtusifolium Nees. | Ref. |
Plantae | Lauraceae | Cinnamomum spp. | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Malvaceae | Theobroma cacao | Ref. |
Plantae | Pinaceae | Pinus radiata | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Polygonaceae | Fagopyrum esculentum | Ref. |
Plantae | Polygonaceae | Fagopyrum homotropicum | Ref. |
Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
Plantae | Rosaceae | Malus sylvestris | Ref. |
Plantae | Rosaceae | Rubus spp. | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
Organism | Vitis vinifera | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Fletcher,J.Chem.Soc.Perkin Trans.,1,(1977),1628 |
---|
|