Name |
Sarsasapogenin |
Formula |
C27H44O3 |
Mw |
416.32904527 |
CAS RN |
126-19-2 |
C_ID |
C00003590
,
|
InChIKey |
GMBQZIIUCVWOCD-RCISUQKONA-N |
InChICode |
InChI=1S/C27H44O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h16-24,28H,5-15H2,1-4H3/t16-,17-,18+,19-,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1 |
SMILES |
C1[C@@H](C[C@@H]2[C@](C1)([C@@H]1[C@@H](CC2)[C@H]2[C@](CC1)([C@@H]1[C@H](C2)O[C@]2([C@H]1C)OC[C@H](CC2)C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Agavaceae | Yucca angustissima | Ref. |
Plantae | Agavaceae | Yucca arizonica | Ref. |
Plantae | Agavaceae | Yucca baccata | Ref. |
Plantae | Agavaceae | Yucca baileyi | Ref. |
Plantae | Agavaceae | Yucca brevifolia Engelm. | Ref. |
Plantae | Agavaceae | Yucca confinis | Ref. |
Plantae | Agavaceae | Yucca decipiens | Ref. |
Plantae | Agavaceae | Yucca elata Engelm. | Ref. |
Plantae | Agavaceae | Yucca filifera | Ref. |
Plantae | Agavaceae | Yucca glauca Nutt. | Ref. |
Plantae | Agavaceae | Yucca harrimannii | Ref. |
Plantae | Agavaceae | Yucca jalicensis | Ref. |
Plantae | Agavaceae | Yucca rigida | Ref. |
Plantae | Agavaceae | Yucca schidigera | Ref. |
Plantae | Agavaceae | Yucca schottii Engelm. | Ref. |
Plantae | Agavaceae | Yucca thornberi | Ref. |
Plantae | Agavaceae | Yucca torreyi | Ref. |
Plantae | Agavaceae | Yucca treculeana Hook. | Ref. |
Plantae | Agavaceae | Yucca valida | Ref. |
Plantae | Anemarrhenaceae | Anemarrhena asphodeloides | Ref. |
Plantae | Asparagaceae | Asparagus broussonetii | Ref. |
Plantae | Asparagaceae | Asparagus cochinchinensis | Ref. |
Plantae | Asparagaceae | Asparagus racemosus | Ref. |
Plantae | Asparagaceae | Asparagus spp. | Ref. |
Plantae | Dioscoreaceae | Dioscorea colletii | Ref. |
Plantae | Smilacaceae | Smilax lanceolata | Ref. |
Plantae | Smilacaceae | Smilax rotundifolia | Ref. |
Plantae | Smilacaceae | Smilax spp. | Ref. |
- | - | Radix sarsaparilla | Ref. |
- | - | Radix sarsaparillae | Ref. |
|
|
zoom in
Organism | Asparagus cochinchinensis | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|