Name |
beta-Eudesmene beta-Selinene |
Formula |
C15H24 |
Mw |
204.18780077 |
CAS RN |
17066-67-0 |
C_ID |
C00003186
, 
|
InChIKey |
YOVSPTNQHMDJAG-QRSVUVFUNA-N |
InChICode |
InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3/t13-,14+,15-/m1/s1 |
SMILES |
C1CC(=C)[C@H]2[C@](C1)(CC[C@H](C2)C(=C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
Plantae | Annonaceae | Xylopia frutescens  | Ref. |
Plantae | Annonaceae | Xylopia parviflora  | Ref. |
Plantae | Apiaceae | Apium graveolens  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
Plantae | Apiaceae | Seseli spp. | Ref. |
Plantae | Araliaceae | Panax ginseng  | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Atractylodes chinensis  | Ref. |
Plantae | Asteraceae | Atractylodes lancea  | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Centaurea orientalis | Ref. |
Plantae | Asteraceae | Cyathocline purpurea | Ref. |
Plantae | Asteraceae | Dittrichia graveolens  | Ref. |
Plantae | Asteraceae | Laggera alata var.alata  | Ref. |
Plantae | Asteraceae | Petasites albus  | Ref. |
Plantae | Asteraceae | Petasites hybridus  | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Asteraceae | Saussurea lappa  | Ref. |
Plantae | Asteraceae | Senecio vulgaris  | Ref. |
Plantae | Asteraceae | Solidago canadensis | Ref. |
Plantae | Burseraceae | Commiphora holtziana | Ref. |
Plantae | Cannabaceae | Humulus lupulus  | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
Plantae | Cyperaceae | Cyperus rotundus  | Ref. |
Plantae | Fabaceae | Copaifera duckei | Ref. |
Plantae | Fabaceae | Copaifera guianensis  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
Plantae | Myrtaceae | Psidium guajava  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Fortunella margarita  | Ref. |
Plantae | Rutaceae | Murraya paniculata  | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
|
|
zoom in
Organism | Saussurea lappa | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
---|
|