| Name |
Malvidin |
| Formula |
C17H15O7 |
| Mw |
331.08177783 |
| CAS RN |
643-84-5 |
| C_ID |
C00020647
, 
|
| InChIKey |
KZMACGJDUUWFCH-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1 |
| SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O)c1cc(c(c(c1)OC)O)OC)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus G.Don.  | Ref. |
| Plantae | Balsaminaceae | Impatiens balsamina | Ref. |
| Plantae | Cruciferae | Brassica napa | Ref. |
| Plantae | Fabaceae | Andira inermis | Ref. |
| Plantae | Fabaceae | Calopogonium caeruleum | Ref. |
| Plantae | Fabaceae | Canavalia ensiformis | Ref. |
| Plantae | Fabaceae | Canavalia rosea | Ref. |
| Plantae | Fabaceae | Centrosema plumieri | Ref. |
| Plantae | Fabaceae | Centrosema pubescens | Ref. |
| Plantae | Fabaceae | Cercis siliquastrum | Ref. |
| Plantae | Fabaceae | Clitoria ternatea | Ref. |
| Plantae | Fabaceae | Indigofera potaninii | Ref. |
| Plantae | Fabaceae | Lathyrus angulatus | Ref. |
| Plantae | Fabaceae | Lathyrus heterophyllus | Ref. |
| Plantae | Fabaceae | Lathyrus hirsutus | Ref. |
| Plantae | Fabaceae | Lathyrus latifolius | Ref. |
| Plantae | Fabaceae | Lathyrus linifolius | Ref. |
| Plantae | Fabaceae | Lathyrus niger | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus | Ref. |
| Plantae | Fabaceae | Lathyrus palustris | Ref. |
| Plantae | Fabaceae | Lathyrus sativus | Ref. |
| Plantae | Fabaceae | Lathyrus sylvestris | Ref. |
| Plantae | Fabaceae | Lathyrus tingitanus | Ref. |
| Plantae | Fabaceae | Lathyrus vernus | Ref. |
| Plantae | Fabaceae | Medicago sativa | Ref. |
| Plantae | Fabaceae | Parkia biglobosa | Ref. |
| Plantae | Fabaceae | Pisum sativum | Ref. |
| Plantae | Fabaceae | Trifolium pratense | Ref. |
| Plantae | Fabaceae | Vigna vexillata | Ref. |
| Plantae | Myrtaceae | Syzygium cumini | Ref. |
| Plantae | Myrtaceae | Syzygium jambos | Ref. |
| Plantae | Solanaceae | Solanum tuberosum subsp. Andigena | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Medicago sativa |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
