Name |
Eriodictyol (+)-Eriodictyol (+)-Eriodictol |
Formula |
C15H12O6 |
Mw |
288.06338812 |
CAS RN |
552-58-9 |
C_ID |
C00000960
, 
|
InChIKey |
SBHXYTNGIZCORC-UGPWUYPHNA-N |
InChICode |
InChI=1S/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2/t13-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Anthemis altissima  | Ref. |
Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
Plantae | Asteraceae | Eupatorium subhastatum  | Ref. |
Plantae | Asteraceae | Filifolium sibiricum | Ref. |
Plantae | Asteraceae | Helichrysum bracteatum (Vent.)Andr. | Ref. |
Plantae | Asteraceae | Onopordum acanthium  | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
Plantae | Asteraceae | Tessaria dodoneifolia | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica  | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia conrauana | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia livingstonei  | Ref. |
Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
Plantae | Ericaceae | Lyonia ovalifolia  | Ref. |
Plantae | Fabaceae | Arachis hypogaea  | Ref. |
Plantae | Fabaceae | Bauhinia guianensis  | Ref. |
Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
Plantae | Fabaceae | Dipteryx odorata  | Ref. |
Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
Plantae | Fabaceae | Spatholobus suberectus Dunn  | Ref. |
Plantae | Fabaceae | Vicia faba  | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon californicum  | Ref. |
Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
Plantae | Labiatae | Mentha longifolia  | Ref. |
Plantae | Labiatae | Phlomis nissolii | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Satureja subspicata  | Ref. |
Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Rosaceae | Prunus armygdalus | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rutaceae | Citrus unshiu Markovich  | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
- | - | Saracha punctata | Ref. |
|
|
zoom in
Organism | Mentha longifolia | Reference | Calixto, et al., Planta Med, 70, (2004), 93.
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
---|
|