Name |
Magnoflorine (+)-Magnoflorine Escholin Escholine Thalictrin Thalictrine |
Formula |
C20H24NO4 |
Mw |
342.17053326 |
CAS RN |
2141-09-5 |
C_ID |
C00001885
,
|
InChIKey |
YLRXAIKMLINXQY-UGPWUYPHNA-O |
InChICode |
InChI=1S/C20H23NO4/c1-21(2)8-7-12-10-15(25-4)20(23)18-16(12)13(21)9-11-5-6-14(24-3)19(22)17(11)18/h5-6,10,13H,7-9H2,1-4H3,(H-,22,23)/p+1/t13-/m0/s1 |
SMILES |
c1(c2c3c(cc1OC)CC[N+]([C@H]3Cc1c2c(c(cc1)OC)O)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Monodora junodii | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Annonaceae | Xylopia vieillardi | Ref. |
Plantae | Aristolochiaceae | Aristolochia clematitis | Ref. |
Plantae | Aristolochiaceae | Aristolochia contorta | Ref. |
Plantae | Aristolochiaceae | Aristolochia debilis | Ref. |
Plantae | Aristolochiaceae | Aristolochia elegans | Ref. |
Plantae | Aristolochiaceae | Aristolochia fangchi | Ref. |
Plantae | Aristolochiaceae | Aristolochia gigantea | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla | Ref. |
Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
Plantae | Aristolochiaceae | Aristolochia moupinensis | Ref. |
Plantae | Aristolochiaceae | Aristolochia sipho | Ref. |
Plantae | Aristolochiaceae | Aristolochia thunbergii | Ref. |
Plantae | Aristolochiaceae | Aristolochia triangularis | Ref. |
Plantae | Berberidaceae | Berberis amurensis | Ref. |
Plantae | Berberidaceae | Berberis crataegina | Ref. |
Plantae | Berberidaceae | Berberis iliensis | Ref. |
Plantae | Berberidaceae | Berberis integerrima | Ref. |
Plantae | Berberidaceae | Berberis kawakamii | Ref. |
Plantae | Berberidaceae | Berberis numularis | Ref. |
Plantae | Berberidaceae | Berberis thunbergii | Ref. |
Plantae | Berberidaceae | Berberis vulgaris | Ref. |
Plantae | Berberidaceae | Caulophyllum thalicroides | Ref. |
Plantae | Berberidaceae | Caulophyllum thalictroides | Ref. |
Plantae | Berberidaceae | Epimedium brevicornum | Ref. |
Plantae | Berberidaceae | Mahonia fortunei | Ref. |
Plantae | Berberidaceae | Mahonia japonica | Ref. |
Plantae | Euphorbiaceae | Croton cumingii | Ref. |
Plantae | Euphorbiaceae | Croton lechleri Mull.Arg. | Ref. |
Plantae | Fumariaceae | Corydalis intermedia | Ref. |
Plantae | Fumariaceae | Corydalis spp. | Ref. |
Plantae | Lauraceae | Litsea deccanensis | Ref. |
Plantae | Magnoliaceae | Magnolia accuminata | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia grandiflora | Ref. |
Plantae | Magnoliaceae | Magnolia kobus | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Magnoliaceae | Magnolia soulangeana | Ref. |
Plantae | Magnoliaceae | Magnolia speciosa | Ref. |
Plantae | Menispermaceae | Cissampelos pareira | Ref. |
Plantae | Menispermaceae | Cocculus carolinus | Ref. |
Plantae | Menispermaceae | Cocculus trilobus | Ref. |
Plantae | Menispermaceae | Diploclisia glaucescens | Ref. |
Plantae | Menispermaceae | Sinomenium acutum | Ref. |
Plantae | Menispermaceae | Stephania cepharantha | Ref. |
Plantae | Menispermaceae | Tinospora cordifolia | Ref. |
Plantae | Menispermaceae | Tinospora malabrica | Ref. |
Plantae | Papaveraceae | Argemone platyceras Link et Otto | Ref. |
Plantae | Papaveraceae | Argemone polyanthemos | Ref. |
Plantae | Papaveraceae | Argemone spp. | Ref. |
Plantae | Papaveraceae | Chelidonium spp. | Ref. |
Plantae | Papaveraceae | Dicranostigma spp. | Ref. |
Plantae | Papaveraceae | Eschscholzia californica | Ref. |
Plantae | Papaveraceae | Eschscholzia spp. | Ref. |
Plantae | Papaveraceae | Glaucium arabicum | Ref. |
Plantae | Papaveraceae | Glaucium flavum | Ref. |
Plantae | Papaveraceae | Glaucium spp. | Ref. |
Plantae | Papaveraceae | Meconopsis cambrica | Ref. |
Plantae | Papaveraceae | Meconopsis robusta | Ref. |
Plantae | Papaveraceae | Meconopsis spp. | Ref. |
Plantae | Papaveraceae | Papaver orientale | Ref. |
Plantae | Papaveraceae | Papaver rhoeas | Ref. |
Plantae | Papaveraceae | Papaver setigerum | Ref. |
Plantae | Papaveraceae | Papaver somniferum | Ref. |
Plantae | Papaveraceae | Papaver spp. | Ref. |
Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
Plantae | Ranunculaceae | Aconitum callibotryon | Ref. |
Plantae | Ranunculaceae | Aconitum vulparia | Ref. |
Plantae | Ranunculaceae | Actaea racemosa | Ref. |
Plantae | Ranunculaceae | Actaea spicata | Ref. |
Plantae | Ranunculaceae | Aquilegia olympica | Ref. |
Plantae | Ranunculaceae | Asteropyrum cavaleriei | Ref. |
Plantae | Ranunculaceae | Caltha palustris | Ref. |
Plantae | Ranunculaceae | Clematis parviloba | Ref. |
Plantae | Ranunculaceae | Coptis chinensis | Ref. |
Plantae | Ranunculaceae | Coptis deltoidea | Ref. |
Plantae | Ranunculaceae | Coptis japonica | Ref. |
Plantae | Ranunculaceae | Coptis teetoides | Ref. |
Plantae | Ranunculaceae | Delphinium fangshanense W.T. | Ref. |
Plantae | Ranunculaceae | Delphinium pentagynum | Ref. |
Plantae | Ranunculaceae | Paraquilegia anemonoides | Ref. |
Plantae | Ranunculaceae | Ranunculus serbicus | Ref. |
Plantae | Ranunculaceae | Thalictrum baicalense | Ref. |
Plantae | Ranunculaceae | Thalictrum dasycarpum | Ref. |
Plantae | Ranunculaceae | Thalictrum delavayi | Ref. |
Plantae | Ranunculaceae | Thalictrum flavum L. | Ref. |
Plantae | Ranunculaceae | Thalictrum foetidum | Ref. |
Plantae | Ranunculaceae | Thalictrum foliolosum | Ref. |
Plantae | Ranunculaceae | Thalictrum foliosum | Ref. |
Plantae | Ranunculaceae | Thalictrum isopyroides | Ref. |
Plantae | Ranunculaceae | Thalictrum longipedunculatum | Ref. |
Plantae | Ranunculaceae | Thalictrum minums | Ref. |
Plantae | Ranunculaceae | Thalictrum minus | Ref. |
Plantae | Ranunculaceae | Thalictrum przewalskii | Ref. |
Plantae | Ranunculaceae | Thalictrum symplex | Ref. |
Plantae | Ranunculaceae | Thalictrum thalictroides | Ref. |
Plantae | Ranunculaceae | Thalictrum thunbergii | Ref. |
Plantae | Ranunculaceae | Thalictrum wangii | Ref. |
Plantae | Rhamnaceae | Zizyphus jujuba var. spinosa | Ref. |
Plantae | Rosaceae | Potentilla discolor | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Rutaceae | Phellodendron chinense | Ref. |
Plantae | Rutaceae | Phellodendron chinense var.glabriusculum | Ref. |
Plantae | Rutaceae | Zanthoxylum chalybeum | Ref. |
Plantae | Rutaceae | Zanthoxylum myriacanthum | Ref. |
Plantae | Rutaceae | Zanthoxylum nitidum | Ref. |
Plantae | Rutaceae | Zanthoxylum spp. | Ref. |
Plantae | Rutaceae | Zanthoxylum usambarensis | Ref. |
- | - | Dilphinium caeruleum | Ref. |
|
|
zoom in
Organism | Epimedium brevicornum | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chen, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 29, (1994), 506.
Zhang, China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 14, (1998), 53.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chang, et al., Dictionary of Chemistry, Science Press, Beijing, (2008) |
---|
|