Name |
Callistephin Pelargonidin 3-O-beta-D-glucopyranoside |
Formula |
C21H21O10 |
Mw |
433.11347189 |
CAS RN |
18466-51-8 |
C_ID |
C00006630
, 
|
InChIKey |
ABVCUBUIXWJYSE-DNLILFCWNA-O |
InChICode |
InChI=1S/C21H20O10/c22-8-16-17(26)18(27)19(28)21(31-16)30-15-7-12-13(25)5-11(24)6-14(12)29-20(15)9-1-3-10(23)4-2-9/h1-7,16-19,21-22,26-28H,8H2,(H2-,23,24,25)/p+1/t16-,17-,18+,19-,21-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Callistephus chinensis | Ref. |
Plantae | Balsaminaceae | Impatiens balsamina  | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera caerulea | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
Plantae | Convolvulaceae | Ipomoea nil  | Ref. |
Plantae | Cruciferae | Matthiola incana  | Ref. |
Plantae | Euphorbiaceae | Poinsettia spp. | Ref. |
Plantae | Fabaceae | Erythrina spp. | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Myrsinaceae | Anagallis arvensis  | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
Plantae | Orchidaceae | Broughtonia spp. | Ref. |
Plantae | Passifloraceae | Passiflora edulis  | Ref. |
Plantae | Passifloraceae | Passiflora suberosa | Ref. |
Plantae | Phrymaceae | Mimulus cardinalis | Ref. |
Plantae | Phrymaceae | Mimulus lewisii | Ref. |
Plantae | Plantaginaceae | Penstemon spp. | Ref. |
Plantae | Poaceae | Zea mays  | Ref. |
Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
Plantae | Rosaceae | Fragaria x ananassa | Ref. |
Plantae | Rosaceae | Prunus spp.  | Ref. |
Plantae | Rosaceae | Rosa spp. | Ref. |
Plantae | Rosaceae | Rubus spp.  | Ref. |
Plantae | Solanaceae | Petunia exserta | Ref. |
Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
Organism | Rubus spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter, Ann.,412,(1916),149 |
---|
|