| Name |
(-)-Epigallocatechin
Epigallocatechin
L-Epigallocatechin
l-Epigallocatechin |
| Formula |
C15H14O7 |
| Mw |
306.0739528 |
| CAS RN |
970-74-1 |
| C_ID |
C00008818
, 
|
| InChIKey |
XMOCLSLCDHWDHP-JTFITGRYNA-N |
| InChICode |
InChI=1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15-/m1/s1 |
| SMILES |
c1(cc(c2c(c1)O[C@@H]([C@@H](C2)O)c1cc(c(c(c1)O)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Salacia prinoides | Ref. |
| Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
| Plantae | Cistaceae | Cistus salviifolius | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
| Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
| Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron dichroanthum ssp.scyphocalyx | Ref. |
| Plantae | Ericaceae | Rhododendron micranthum | Ref. |
| Plantae | Ericaceae | Rhododendron oreotrephes | Ref. |
| Plantae | Ericaceae | Rhododendron praevernum | Ref. |
| Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
| Plantae | Ericaceae | Rhododendron ungernii | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
| Plantae | Euphorbiaceae | Croton lechleri | Ref. |
| Plantae | Fabaceae | Acacia nilotica | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Stryphnodendron adstringens | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Malvaceae | Guazuma ulmifolia | Ref. |
| Plantae | Myricaceae | Myrica rubra | Ref. |
| Plantae | Myrtaceae | Syzygium spp. | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola L. | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
|
|
zoom in
| Organism | Phyllanthus emblica |
|---|
| Reference | Chaubal, et al., Planta Med, 69, (2003), 287.
Takano, et al., Planta Med, 69, (2003), 321.
KISHI, et al., Chem Pharm Bull, 51, (2003), 1051.
OHASHI, et al., Chem Pharm Bull, 51, (2003), 343.
MATSUDA, et al., Chem Pharm Bull, 50, (2002), 208.
Zhang, et al., Journal of Natural Products, 64, (2001), 1527.
Tu, Chinese Traditional and Herbal Drugs(Zhongcaoyao), 22, (1991), 419.
Cui, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 18, (1987), 297.
Zhu, et al., Tea, 16, (1990), 40.
Chem Abstr, 106, (1987), P4873s.
Chem Abstr, 114, (1991), P171330j.
Chem Abstr, 118, (1993), 37881u.
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Zhang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 549. |
|---|
|
