Name |
Kaempferol 3-O-methyl ether Isokaempferide Kaempferol 3-methyl ether 5,7,4'-trihydroxy-3-methoxyflavone |
Formula |
C16H12O6 |
Mw |
300.06338812 |
CAS RN |
1592-70-7 |
C_ID |
C00001062
,
|
InChIKey |
VJJZJBUCDWKPLC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O6/c1-21-16-14(20)13-11(19)6-10(18)7-12(13)22-15(16)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
Plantae | Asteraceae | Centaurea clementei | Ref. |
Plantae | Asteraceae | Chrysothamnus humilis | Ref. |
Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
Plantae | Asteraceae | Flourensia hirsuta | Ref. |
Plantae | Asteraceae | Flourensia ilicifolia | Ref. |
Plantae | Asteraceae | Haplopappus deserticola | Ref. |
Plantae | Asteraceae | Serratula wolfi | Ref. |
Plantae | Asteraceae | Viguiera gardneri | Ref. |
Plantae | Betulaceae | Betula nigra | Ref. |
Plantae | Combretaceae | Combretum quadrangulare | Ref. |
Plantae | Fabaceae | Acacia neovernicosa | Ref. |
Plantae | Fabaceae | Cassia javanica | Ref. |
Plantae | Fabaceae | Crotalaria madurensis | Ref. |
Plantae | Fabaceae | Genista ephedroides | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Prosopis glandulosa | Ref. |
Plantae | Fabaceae | Prosopis juliflora | Ref. |
Plantae | Fabaceae | Prosopis laevigata | Ref. |
Plantae | Fabaceae | Rhynchosia rufescens | Ref. |
Plantae | Geraniaceae | Geranium macrorrhizum L. | Ref. |
Plantae | Labiatae | Salvia glutinosa | Ref. |
Plantae | Labiatae | Salvia yosgadensis | Ref. |
Plantae | Nymphaeaceae | Nymphaea stellata | Ref. |
Plantae | Pteridaceae | Notholaena standleyi | Ref. |
Plantae | Solanaceae | Solanum sarrachoides | Ref. |
Plantae | Zingiberaceae | Zingiber aromaticum | Ref. |
Plantae | Zygophyllaceae | Larrea tridentata | Ref. |
|
|
zoom in
Organism | Solanum sarrachoides | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Abou-Gazar, et al., Phytochemistry, 65, (2004), 2499.
Usia, et al., Journal of Natural Products, 65, (2002), 1079 |
---|
|