Name |
(E)-Nerolidol E-Nerolidol trans-Nerolidol |
Formula |
C15H26O |
Mw |
222.19836545 |
CAS RN |
40716-66-3 |
C_ID |
C00029339
,
|
InChIKey |
FQTLCLSUCSAZDY-SDNWHVSQNA-N |
InChICode |
InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+/t15-/m0/s1 |
SMILES |
C(=C(\CCC=C(C)C)/C)/CC[C@](C=C)(O)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti | Ref. |
Plantae | Asteraceae | Lychnophora ericoides Mart. | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
Plantae | Asteraceae | Senecio vulgaris | Ref. |
Plantae | Cannabaceae | Cannabis inflorescences | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus resinifera | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Fortunella margarita | Ref. |
Plantae | Rutaceae | Murraya exotica | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Rutaceae | Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
Plantae | Santalaceae | Santalum spicatum | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Solanaceae | Nicotiana alata | Ref. |
Plantae | Verbenaceae | Lantana camara L. | Ref. |
Plantae | Zingiberaceae | Hedychium coronarium | Ref. |
Plantae | Zingiberaceae | Zingiber cassumunar Roxb. | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
Organism | Hedychium coronarium | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
MORIKAWA, et al., Chem Pharm Bull, 50, (2002), 1045 |
---|
|