| Name |
7-(beta-D-glucopyranosyloxy)-6-methoxycoumarin
Scopolin |
| Formula |
C16H18O9 |
| Mw |
354.09508217 |
| CAS RN |
531-44-2 |
| C_ID |
C00002500
, 
|
| InChIKey |
SGTCGCCQZOUMJJ-JXQFOPSLNA-N |
| InChICode |
InChI=1S/C16H18O9/c1-22-9-4-7-2-3-12(18)23-8(7)5-10(9)24-16-15(21)14(20)13(19)11(6-17)25-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13-,14+,15-,16-/m1/s1 |
| SMILES |
c1(c(cc2c(c1)ccc(=O)o2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Hymenochaetaceae | Phellinus igniarius  | Ref. |
| Plantae | Anacardiaceae | Rhus lanceolata | Ref. |
| Plantae | Apocynaceae | Nerium odorum | Ref. |
| Plantae | Araliaceae | Hedera spp. | Ref. |
| Plantae | Asteraceae | Anthemis spp. | Ref. |
| Plantae | Asteraceae | Artemisia annua | Ref. |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Asteraceae | Artemisia spp. | Ref. |
| Plantae | Asteraceae | Helianthus annuus | Ref. |
| Plantae | Convolvulaceae | Erycibe obtusifolia | Ref. |
| Plantae | Convolvulaceae | Erycibe schmidtii | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Euphorbiaceae | Macaranga tanarius | Ref. |
| Plantae | Fabaceae | Astragalus brachycarpus | Ref. |
| Plantae | Fabaceae | Astragalus falcatus | Ref. |
| Plantae | Fabaceae | Baptisia arachnifera | Ref. |
| Plantae | Fabaceae | Baptisia bracteata | Ref. |
| Plantae | Fabaceae | Baptisia calycosa | Ref. |
| Plantae | Fabaceae | Baptisia cinerea | Ref. |
| Plantae | Fabaceae | Baptisia lanceolata | Ref. |
| Plantae | Fabaceae | Baptisia nuttalliana | Ref. |
| Plantae | Fabaceae | Baptisia perfoliata | Ref. |
| Plantae | Fabaceae | Baptisia simplicifolia | Ref. |
| Plantae | Fabaceae | Baptisia tinctoria | Ref. |
| Plantae | Gentianaceae | Swertia spp. | Ref. |
| Plantae | Moraceae | Morus alba L. | Ref. |
| Plantae | Rutaceae | Murraya paniculata | Ref. |
| Plantae | Sapindaceae | Aesculus pavia L. | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum | Ref. |
| Plantae | Solanaceae | Scopolia japonica | Ref. |
| Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense | Ref. |
| Plantae | Ulmaceae | Celtis spp. | Ref. |
|
|
zoom in
| Organism | Nicotiana tabacum |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Xie, et al., Chapter 28, JIU LI XIANG, in Modern Stydies of Chinese Herbal Medicine, edited. By Institute of Materia Medica, Chinese Academy of Medical Sciences, Vol.2, 333-61, Union Press of Beijing Medical University and Peking Union Medical College, Geijing, (1996).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
DOI, et al., Chem Pharm Bull, 49, (2001), 151.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter35 |
|---|
|
