Name |
Velutin Flavoyadorigenin B Luteolin 7,3'-dimethyl ether 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
Formula |
C17H14O6 |
Mw |
314.07903818 |
CAS RN |
25739-41-7 |
C_ID |
C00003867
,
|
InChIKey |
ROCUOVBWAWAQFD-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O6/c1-21-10-6-12(19)17-13(20)8-14(23-16(17)7-10)9-3-4-11(18)15(5-9)22-2/h3-8,18-19H,1-2H3 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia caerulescens | Ref. |
Plantae | Asteraceae | Artemisia iwayomogi | Ref. |
Plantae | Asteraceae | Artemisia oliveriana | Ref. |
Plantae | Asteraceae | Bahia glandulosa | Ref. |
Plantae | Asteraceae | Bracteantha viscosa | Ref. |
Plantae | Asteraceae | Chromolaena meridensis | Ref. |
Plantae | Asteraceae | Gnaphalium gaudichaudianum DC | Ref. |
Plantae | Asteraceae | Haplopappus bailahuen | Ref. |
Plantae | Asteraceae | Helichrysum bracteatum | Ref. |
Plantae | Asteraceae | Heterotheca pilosa | Ref. |
Plantae | Asteraceae | Madia sativa | Ref. |
Plantae | Asteraceae | Senecio viscosus | Ref. |
Plantae | Boraginaceae | Nonea lutea | Ref. |
Plantae | Boraginaceae | Nonea pulla | Ref. |
Plantae | Cistaceae | Cistus clusii | Ref. |
Plantae | Cunoniaceae | Eucryphia spp. | Ref. |
Plantae | Cyperaceae | Trichophorum cespitosum | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon sessilifolium | Ref. |
Plantae | Hydrophyllaceae | Wigandia urens | Ref. |
Plantae | Labiatae | Salvia candidissima | Ref. |
Plantae | Labiatae | Salvia chinopeplica | Ref. |
Plantae | Labiatae | Salvia chionopeplica | Ref. |
Plantae | Labiatae | Salvia sclarea | Ref. |
Plantae | Labiatae | Teucrium marum | Ref. |
Plantae | Malvaceae | Kitaibela vitifolia | Ref. |
Plantae | Monocleaceae | Monoclea gottschei | Ref. |
Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
Plantae | Plantaginaceae | Antirrhinum spp. | Ref. |
Plantae | Plantaginaceae | Veronica flexuosa | Ref. |
Plantae | Rhamnaceae | Ceanothus velutinus | Ref. |
Plantae | Solanaceae | Petunia parviflora | Ref. |
Plantae | Solanaceae | Salpiglossis sinuata | Ref. |
Plantae | Thymelaeaceae | Lethedon tannaensis | Ref. |
Plantae | Verbenaceae | Lantana montevidensis | Ref. |
Plantae | Winteraceae | Drimys winteri | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata | Ref. |
Plantae | Zygophyllaceae | Larrea tridentata | Ref. |
|
|
zoom in
Organism | Ceanothus velutinus | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Das,J.Org.Chem.,35,(1970),3989
Williams,Phytochem.,21,(1982),329 |
---|
|