Name |
Linolenic acid (Z,Z,Z)-Octadeca-9,12,15-trienoic acid alpha-Linolenic acid |
Formula |
C18H30O2 |
Mw |
278.2245802 |
CAS RN |
463-40-1 |
C_ID |
C00007247
|
InChIKey |
DTOSIQBPPRVQHS-PDBXOOCHSA-N |
InChICode |
InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9- |
SMILES |
OC(CCCCCCC/C=CC/C=CC/C=CCC)=O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Fungi | Agaricaceae | Psalliota bispora | Ref. |
Fungi | Clavicipitaceae | Cordyceps sinensis  | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Araliaceae | Acanthopanax gracilistylus  | Ref. |
Plantae | Asphodelaceae | Aloe vera var.chinensis  | Ref. |
Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
Plantae | Asteraceae | Silybum marianum  | Ref. |
Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
Plantae | Boraginaceae | Echium auberianum | Ref. |
Plantae | Boraginaceae | Echium boissieri | Ref. |
Plantae | Boraginaceae | Echium gentianoides | Ref. |
Plantae | Boraginaceae | Echium giganteum | Ref. |
Plantae | Boraginaceae | Echium lusitanicum | Ref. |
Plantae | Boraginaceae | Echium pitardii | Ref. |
Plantae | Boraginaceae | Echium plantagineum  | Ref. |
Plantae | Boraginaceae | Echium sabulicola | Ref. |
Plantae | Boraginaceae | Echium strictum | Ref. |
Plantae | Boraginaceae | Echium vulgare  | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata  | Ref. |
Plantae | Chlorellaceae | Chlorella vulgaris | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Lepidium meyenii Maca  | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
Plantae | Euphorbiaceae | Anabaena flos-aquae | Ref. |
Plantae | Euphorbiaceae | Croton tiglium  | Ref. |
Plantae | Fabaceae | Astragalus mongholicus | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
Plantae | Fabaceae | Vicia faba  | Ref. |
Plantae | Labiatae | Perilla frutescens var.arguta  | Ref. |
Plantae | Linaceae | Linum usitatissimum  | Ref. |
Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
Plantae | Meliaceae | Azadirachta indica  | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
Plantae | Oleaceae | Jasminum auriculatum  | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Poaceae | Triticum aestivum  | Ref. |
Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
Plantae | Rosaceae | Potentilla asiatica | Ref. |
Plantae | Rosaceae | Potentilla desertorum | Ref. |
Plantae | Rosaceae | Potentilla orientalis | Ref. |
Plantae | Rosaceae | Prunus armeniaca  | Ref. |
Plantae | Solanaceae | Lycium chinense  | Ref. |
Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Typhaceae | Typha domingensis P.  | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Poterium polygamum | Ref. |
- | - | Scurrura atropurpurea | Ref. |
|
|
zoom in
Organism | Trichosanthes rosthornii | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
OHASHI, et al., Chem Pharm Bull, 51, (2003), 343.
Morikawa, et al., Journal of Natural Products, 65, (2002), 1468.
Park, et al., Planta Med, 69, (2003), 459 |
---|
|