| Name |
Leurosine |
| Formula |
C46H56N4O9 |
| Mw |
808.40472942 |
| CAS RN |
23360-92-1 |
| C_ID |
C00001744
, 
|
| InChIKey |
LPGWZGMPDKDHEP-RGLLKGLVNA-N |
| InChICode |
InChI=1S/C46H56N4O9/c1-8-42-16-12-18-50-20-17-44(37(42)50)30-21-31(34(55-5)22-33(30)48(4)38(44)46(54,41(53)57-7)39(42)58-26(3)51)45(40(52)56-6)23-27-24-49(25-43(9-2)36(27)59-43)19-15-29-28-13-10-11-14-32(28)47-35(29)45/h10-14,16,21-22,27,36-39,47,54H,8-9,15,17-20,23-25H2,1-7H3/t27-,36-,37-,38-,39-,42-,43+,44-,45+,46+/m1/s1 |
| SMILES |
c1cc2c(cc1)c1c([nH]2)[C@](C[C@@H]2CN(CC1)C[C@]1([C@@H]2O1)CC)(c1c(cc2c(c1)[C@@]13[C@@H](N2C)[C@@]([C@@H]([C@]2([C@H]1N(CC=C2)CC3)CC)OC(=O)C)(O)C(=O)OC)OC)C(=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus lanceus | Ref. |
| Plantae | Apocynaceae | Catharanthus longifolius | Ref. |
| Plantae | Apocynaceae | Catharanthus ovalis | Ref. |
| Plantae | Apocynaceae | Catharanthus pusillus | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Catharanthus spp. | Ref. |
| Plantae | Apocynaceae | Vinca rosea | Ref. |
|
|
zoom in
| Organism | Catharanthus pusillus |
|---|
| Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
