| Name |
Podophyllotoxone |
| Formula |
C22H20O8 |
| Mw |
412.11581762 |
| CAS RN |
477-49-6 |
| C_ID |
C00002620
, 
|
| InChIKey |
ISCQYPPCSYRZOT-DZPVBXFGNA-N |
| InChICode |
InChI=1S/C22H20O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-19H,8-9H2,1-3H3/t13-,18+,19-/m0/s1 |
| SMILES |
c12c(cc3c(c1)OCO3)C(=O)[C@@H]1[C@@H]([C@@H]2c2cc(c(c(c2)OC)OC)OC)C(=O)OC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Diphylleia sinensis | Ref. |
| Plantae | Berberidaceae | Dysosma majorensis | Ref. |
| Plantae | Berberidaceae | Dysosma pleiantha | Ref. |
| Plantae | Berberidaceae | Podophyllum emodii | Ref. |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum | Ref. |
| Plantae | Berberidaceae | Podophyllum pleianthum | Ref. |
| Plantae | Berberidaceae | Sinopodophyllum hexandrum | Ref. |
| Plantae | Cupressaceae | Juniperus thurifera | Ref. |
|
|
zoom in
| Organism | Podophyllum emodii |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chen, APS, 14, (1979), 101.
Yin, et al., CCMM, 14, (1989), 420.
Fackson, et al., Phytochemistry, 23, (1984), 1147.
Yin, et al., Zhiwu Xuebao, 32, (1990), 45.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
