| Name |
Kaempferol 7-O-rhamnoside
Kaempferol 7-O-alpha-L-rhamnopyranoside
Kaempferol 7-rhamnoside
Kaempferol-7-rhamnoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
20196-89-8 |
| C_ID |
C00005150
, 
|
| InChIKey |
HQNOUCSPWAGQND-OKBQHECNNA-N |
| InChICode |
InChI=1S/C21H20O10/c1-8-15(24)17(26)19(28)21(29-8)30-11-6-12(23)14-13(7-11)31-20(18(27)16(14)25)9-2-4-10(22)5-3-9/h2-8,15,17,19,21-24,26-28H,1H3/t8-,15-,17-,19+,21-/m0/s1 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccc(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
| Plantae | Cactaceae | Cephalocereus senilis | Ref. |
| Plantae | Celastraceae | Celastrus orbiculatus  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium ambrosioides | Ref. |
| Plantae | Chenopodiaceae | Chenopodium murale | Ref. |
| Plantae | Crassulaceae | Hylotelephium mingiinianum | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Sedum ewersii | Ref. |
| Plantae | Crassulaceae | Sedum telephium | Ref. |
| Plantae | Crassulaceae | Sinocrassula indica | Ref. |
| Plantae | Cruciferae | Matthiola incana R.Br. | Ref. |
| Plantae | Cucurbitaceae | Siraitia grosvenori | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Equisetaceae | Equisetum palustre | Ref. |
| Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
| Plantae | Equisetaceae | Equisetum telmateja | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lanata | Ref. |
| Plantae | Fabaceae | Lotus corniculatus | Ref. |
| Plantae | Fabaceae | Macroptilium spp. | Ref. |
| Plantae | Fabaceae | Medicago sativa | Ref. |
| Plantae | Fabaceae | Oxytropis glabra | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
| Plantae | Fabaceae | Robinia neomexicana | Ref. |
| Plantae | Fabaceae | Sophora japonica | Ref. |
| Plantae | Fabaceae | Vigna luteola | Ref. |
| Plantae | Fabaceae | Vigna mungo | Ref. |
| Plantae | Liliaceae | Lilium regale | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Ranunculaceae | Delphinium formosum | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Chenopodium ambrosioides |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001) |
|---|
|
